C15H11ClN2O4 — CID 117255208
5-chloro-3-[(3-hydroxyphenoxy)methyl]imidazo[1,5-a]pyridine-1-carboxylic acid (PubChem CID 117255208) has the molecular formula C15H11ClN2O4 and a molecular weight of 318.72 g/mol. Its IUPAC name is 5-chloro-3-[(3-hydroxyphenoxy)methyl]imidazo[1,5-a]pyridine-1-carboxylic acid.
| Compound Name | 5-chloro-3-[(3-hydroxyphenoxy)methyl]imidazo[1,5-a]pyridine-1-carboxylic acid |
|---|---|
| PubChem CID | 117255208 |
| Molecular Formula | C15H11ClN2O4 |
| Molecular Weight | 318.72 g/mol |
| Exact Mass | 318.04 |
| IUPAC Name | 5-chloro-3-[(3-hydroxyphenoxy)methyl]imidazo[1,5-a]pyridine-1-carboxylic acid |
| SMILES | O=C(O)c1nc(COc2cccc(O)c2)n2c(Cl)cccc12 |
| InChI | InChI=1S/C15H11ClN2O4/c16-12-6-2-5-11-14(15(20)21)17-13(18(11)12)8-22-10-4-1-3-9(19)7-10/h1-7,19H,8H2,(H,20,21) |
| InChIKey | MRTGVDNSUWTBEY-UHFFFAOYSA-N |
| XLogP | 2.97 |
| TPSA | 84.06 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 318.72 |
| LogP ≤ 5 | 2.97 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': '2-halo_pyridine', 'substructure': 'N/A'} |
|---|