C24H33NO — CID 11725523
3,5-ditert-butyl-2-[[[(1S)-2,3-dihydro-1H-inden-1-yl]amino]methyl]phenol (PubChem CID 11725523) has the molecular formula C24H33NO and a molecular weight of 351.53 g/mol. Its IUPAC name is 3,5-ditert-butyl-2-[[[(1S)-2,3-dihydro-1H-inden-1-yl]amino]methyl]phenol.
| Compound Name | 3,5-ditert-butyl-2-[[[(1S)-2,3-dihydro-1H-inden-1-yl]amino]methyl]phenol |
|---|---|
| PubChem CID | 11725523 |
| Molecular Formula | C24H33NO |
| Molecular Weight | 351.53 g/mol |
| Exact Mass | 351.26 |
| IUPAC Name | 3,5-ditert-butyl-2-[[[(1S)-2,3-dihydro-1H-inden-1-yl]amino]methyl]phenol |
| SMILES | CC(C)(C)c1cc(O)c(CN[C@H]2CCc3ccccc32)c(C(C)(C)C)c1 |
| InChI | InChI=1S/C24H33NO/c1-23(2,3)17-13-20(24(4,5)6)19(22(26)14-17)15-25-21-12-11-16-9-7-8-10-18(16)21/h7-10,13-14,21,25-26H,11-12,15H2,1-6H3/t21-/m0/s1 |
| InChIKey | VOWGQIJXNOWLAT-NRFANRHFSA-N |
| XLogP | 5.76 |
| TPSA | 32.26 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 26 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 351.53 |
| LogP ≤ 5 | 5.76 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'mannich_A(296)', 'substructure': 'N/A'} |
|---|