C19H20N4O3 — CID 11725554
5-(4-aminophenyl)-N,9-dimethyl-8,9-dihydro-[1,3]dioxolo[4,5-h][2,3]benzodiazepine-7-carboxamide (PubChem CID 11725554) has the molecular formula C19H20N4O3 and a molecular weight of 352.39 g/mol. Its IUPAC name is 5-(4-aminophenyl)-N,9-dimethyl-8,9-dihydro-[1,3]dioxolo[4,5-h][2,3]benzodiazepine-7-carboxamide.
| Compound Name | 5-(4-aminophenyl)-N,9-dimethyl-8,9-dihydro-[1,3]dioxolo[4,5-h][2,3]benzodiazepine-7-carboxamide |
|---|---|
| PubChem CID | 11725554 |
| Molecular Formula | C19H20N4O3 |
| Molecular Weight | 352.39 g/mol |
| Exact Mass | 352.15 |
| IUPAC Name | 5-(4-aminophenyl)-N,9-dimethyl-8,9-dihydro-[1,3]dioxolo[4,5-h][2,3]benzodiazepine-7-carboxamide |
| SMILES | CNC(=O)N1CC(C)c2cc3c(cc2C(c2ccc(N)cc2)=N1)OCO3 |
| InChI | InChI=1S/C19H20N4O3/c1-11-9-23(19(24)21-2)22-18(12-3-5-13(20)6-4-12)15-8-17-16(7-14(11)15)25-10-26-17/h3-8,11H,9-10,20H2,1-2H3,(H,21,24) |
| InChIKey | WDXVXBAWJUECKW-UHFFFAOYSA-N |
| XLogP | 2.51 |
| TPSA | 89.18 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 352.39 |
| LogP ≤ 5 | 2.51 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'} |
|---|