C8H7ClN2S — CID 117256709
(8-chloroimidazo[1,2-a]pyridin-2-yl)methanethiol (PubChem CID 117256709) has the molecular formula C8H7ClN2S and a molecular weight of 198.68 g/mol. Its IUPAC name is (8-chloroimidazo[1,2-a]pyridin-2-yl)methanethiol.
| Compound Name | (8-chloroimidazo[1,2-a]pyridin-2-yl)methanethiol |
|---|---|
| PubChem CID | 117256709 |
| Molecular Formula | C8H7ClN2S |
| Molecular Weight | 198.68 g/mol |
| Exact Mass | 198.00 |
| IUPAC Name | (8-chloroimidazo[1,2-a]pyridin-2-yl)methanethiol |
| SMILES | SCc1cn2cccc(Cl)c2n1 |
| InChI | InChI=1S/C8H7ClN2S/c9-7-2-1-3-11-4-6(5-12)10-8(7)11/h1-4,12H,5H2 |
| InChIKey | OJZOMMXCPUPHFF-UHFFFAOYSA-N |
| XLogP | 2.42 |
| TPSA | 17.30 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 12 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 198.68 |
| LogP ≤ 5 | 2.42 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'thiol_2', 'substructure': 'N/A'} |
|---|