About 4-[(8-chloroimidazo[1,2-a]pyridin-3-yl)methyl]morpholine
4-[(8-chloroimidazo[1,2-a]pyridin-3-yl)methyl]morpholine (PubChem CID 117256800) has the molecular formula C12H14ClN3O
and a molecular weight of 251.72 g/mol. Its IUPAC name is 4-[(8-chloroimidazo[1,2-a]pyridin-3-yl)methyl]morpholine.
Molecular Properties
| Compound Name | 4-[(8-chloroimidazo[1,2-a]pyridin-3-yl)methyl]morpholine |
| PubChem CID | 117256800 |
| Molecular Formula | C12H14ClN3O |
| Molecular Weight | 251.72 g/mol |
| Exact Mass | 251.08 |
| IUPAC Name | 4-[(8-chloroimidazo[1,2-a]pyridin-3-yl)methyl]morpholine |
| SMILES | Clc1cccn2c(CN3CCOCC3)cnc12 |
| InChI | InChI=1S/C12H14ClN3O/c13-11-2-1-3-16-10(8-14-12(11)16)9-15-4-6-17-7-5-15/h1-3,8H,4-7,9H2 |
| InChIKey | YTWDSCIALNVDQM-UHFFFAOYSA-N |
| XLogP | 1.82 |
| TPSA | 29.77 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 17 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 251.72 |
| LogP ≤ 5 | 1.82 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
Analyze 4-[(8-chloroimidazo[1,2-a]pyridin-3-yl)methyl]morpholine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 4-[(8-chloroimidazo[1,2-a]pyridin-3-yl)methyl]morpholine?
The IUPAC name of 4-[(8-chloroimidazo[1,2-a]pyridin-3-yl)methyl]morpholine (CID 117256800) is 4-[(8-chloroimidazo[1,2-a]pyridin-3-yl)methyl]morpholine.
What is the SMILES notation for 4-[(8-chloroimidazo[1,2-a]pyridin-3-yl)methyl]morpholine?
The canonical SMILES for 4-[(8-chloroimidazo[1,2-a]pyridin-3-yl)methyl]morpholine is Clc1cccn2c(CN3CCOCC3)cnc12.
What is the InChIKey of 4-[(8-chloroimidazo[1,2-a]pyridin-3-yl)methyl]morpholine?
The InChIKey is YTWDSCIALNVDQM-UHFFFAOYSA-N. The full InChI is InChI=1S/C12H14ClN3O/c13-11-2-1-3-16-10(8-14-12(11)16)9-15-4-6-17-7-5-15/h1-3,8H,4-7,9H2.
What are the key properties of 4-[(8-chloroimidazo[1,2-a]pyridin-3-yl)methyl]morpholine?
4-[(8-chloroimidazo[1,2-a]pyridin-3-yl)methyl]morpholine has a molecular weight of 251.72 g/mol, XLogP of 1.82, 2 rotatable bonds, 0 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for 4-[(8-chloroimidazo[1,2-a]pyridin-3-yl)methyl]morpholine is sourced from PubChem (CID 117256800), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).