C10H11BrN4 — CID 117256932
N-[(5-bromo-[1,2,4]triazolo[4,3-a]pyridin-3-yl)methyl]cyclopropanamine (PubChem CID 117256932) has the molecular formula C10H11BrN4 and a molecular weight of 267.13 g/mol. Its IUPAC name is N-[(5-bromo-[1,2,4]triazolo[4,3-a]pyridin-3-yl)methyl]cyclopropanamine.
| Compound Name | N-[(5-bromo-[1,2,4]triazolo[4,3-a]pyridin-3-yl)methyl]cyclopropanamine |
|---|---|
| PubChem CID | 117256932 |
| Molecular Formula | C10H11BrN4 |
| Molecular Weight | 267.13 g/mol |
| Exact Mass | 266.02 |
| IUPAC Name | N-[(5-bromo-[1,2,4]triazolo[4,3-a]pyridin-3-yl)methyl]cyclopropanamine |
| SMILES | Brc1cccc2nnc(CNC3CC3)n12 |
| InChI | InChI=1S/C10H11BrN4/c11-8-2-1-3-9-13-14-10(15(8)9)6-12-7-4-5-7/h1-3,7,12H,4-6H2 |
| InChIKey | SPPPLEMANPQJHP-UHFFFAOYSA-N |
| XLogP | 1.74 |
| TPSA | 42.22 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 267.13 |
| LogP ≤ 5 | 1.74 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': '2-halo_pyridine', 'substructure': 'N/A'} |
|---|