About N-(3,5-dimethylphenyl)-3-(pyridin-4-ylmethylsulfanyl)thiophene-2-carboxamide
N-(3,5-dimethylphenyl)-3-(pyridin-4-ylmethylsulfanyl)thiophene-2-carboxamide (PubChem CID 11725698) has the molecular formula C19H18N2OS2
and a molecular weight of 354.50 g/mol. Its IUPAC name is N-(3,5-dimethylphenyl)-3-(pyridin-4-ylmethylsulfanyl)thiophene-2-carboxamide.
Molecular Properties
| Compound Name | N-(3,5-dimethylphenyl)-3-(pyridin-4-ylmethylsulfanyl)thiophene-2-carboxamide |
| PubChem CID | 11725698 |
| Molecular Formula | C19H18N2OS2 |
| Molecular Weight | 354.50 g/mol |
| Exact Mass | 354.09 |
| IUPAC Name | N-(3,5-dimethylphenyl)-3-(pyridin-4-ylmethylsulfanyl)thiophene-2-carboxamide |
| SMILES | Cc1cc(C)cc(NC(=O)c2sccc2SCc2ccncc2)c1 |
| InChI | InChI=1S/C19H18N2OS2/c1-13-9-14(2)11-16(10-13)21-19(22)18-17(5-8-23-18)24-12-15-3-6-20-7-4-15/h3-11H,12H2,1-2H3,(H,21,22) |
| InChIKey | ZMHKNHZMZLXERJ-UHFFFAOYSA-N |
| XLogP | 5.30 |
| TPSA | 41.99 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 24 |
| Complexity | — |
Lipinski Rule of Five
1 violation
| Rule | Value |
| MW ≤ 500 | 354.50 |
| LogP ≤ 5 | 5.30 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
Analyze N-(3,5-dimethylphenyl)-3-(pyridin-4-ylmethylsulfanyl)thiophene-2-carboxamide with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of N-(3,5-dimethylphenyl)-3-(pyridin-4-ylmethylsulfanyl)thiophene-2-carboxamide?
The IUPAC name of N-(3,5-dimethylphenyl)-3-(pyridin-4-ylmethylsulfanyl)thiophene-2-carboxamide (CID 11725698) is N-(3,5-dimethylphenyl)-3-(pyridin-4-ylmethylsulfanyl)thiophene-2-carboxamide.
What is the SMILES notation for N-(3,5-dimethylphenyl)-3-(pyridin-4-ylmethylsulfanyl)thiophene-2-carboxamide?
The canonical SMILES for N-(3,5-dimethylphenyl)-3-(pyridin-4-ylmethylsulfanyl)thiophene-2-carboxamide is Cc1cc(C)cc(NC(=O)c2sccc2SCc2ccncc2)c1.
What is the InChIKey of N-(3,5-dimethylphenyl)-3-(pyridin-4-ylmethylsulfanyl)thiophene-2-carboxamide?
The InChIKey is ZMHKNHZMZLXERJ-UHFFFAOYSA-N. The full InChI is InChI=1S/C19H18N2OS2/c1-13-9-14(2)11-16(10-13)21-19(22)18-17(5-8-23-18)24-12-15-3-6-20-7-4-15/h3-11H,12H2,1-2H3,(H,21,22).
What are the key properties of N-(3,5-dimethylphenyl)-3-(pyridin-4-ylmethylsulfanyl)thiophene-2-carboxamide?
N-(3,5-dimethylphenyl)-3-(pyridin-4-ylmethylsulfanyl)thiophene-2-carboxamide has a molecular weight of 354.50 g/mol, XLogP of 5.30, 5 rotatable bonds, 1 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for N-(3,5-dimethylphenyl)-3-(pyridin-4-ylmethylsulfanyl)thiophene-2-carboxamide is sourced from PubChem (CID 11725698), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).