C7H8N4S — CID 117257434
(8-amino-[1,2,4]triazolo[4,3-a]pyridin-3-yl)methanethiol (PubChem CID 117257434) has the molecular formula C7H8N4S and a molecular weight of 180.24 g/mol. Its IUPAC name is (8-amino-[1,2,4]triazolo[4,3-a]pyridin-3-yl)methanethiol.
| Compound Name | (8-amino-[1,2,4]triazolo[4,3-a]pyridin-3-yl)methanethiol |
|---|---|
| PubChem CID | 117257434 |
| Molecular Formula | C7H8N4S |
| Molecular Weight | 180.24 g/mol |
| Exact Mass | 180.05 |
| IUPAC Name | (8-amino-[1,2,4]triazolo[4,3-a]pyridin-3-yl)methanethiol |
| SMILES | Nc1cccn2c(CS)nnc12 |
| InChI | InChI=1S/C7H8N4S/c8-5-2-1-3-11-6(4-12)9-10-7(5)11/h1-3,12H,4,8H2 |
| InChIKey | YFJUGLJWZFKCLK-UHFFFAOYSA-N |
| XLogP | 0.74 |
| TPSA | 56.21 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 12 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 180.24 |
| LogP ≤ 5 | 0.74 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'thiol_2', 'substructure': 'N/A'} |
|---|