About 4-([1,2,4]triazolo[1,5-a]pyridin-2-ylmethyl)morpholine
4-([1,2,4]triazolo[1,5-a]pyridin-2-ylmethyl)morpholine (PubChem CID 117257528) has the molecular formula C11H14N4O
and a molecular weight of 218.26 g/mol. Its IUPAC name is 4-([1,2,4]triazolo[1,5-a]pyridin-2-ylmethyl)morpholine.
Molecular Properties
| Compound Name | 4-([1,2,4]triazolo[1,5-a]pyridin-2-ylmethyl)morpholine |
| PubChem CID | 117257528 |
| Molecular Formula | C11H14N4O |
| Molecular Weight | 218.26 g/mol |
| Exact Mass | 218.12 |
| IUPAC Name | 4-([1,2,4]triazolo[1,5-a]pyridin-2-ylmethyl)morpholine |
| SMILES | c1ccn2nc(CN3CCOCC3)nc2c1 |
| InChI | InChI=1S/C11H14N4O/c1-2-4-15-11(3-1)12-10(13-15)9-14-5-7-16-8-6-14/h1-4H,5-9H2 |
| InChIKey | DGPFPFPKEFTZGU-UHFFFAOYSA-N |
| XLogP | 0.56 |
| TPSA | 42.66 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 16 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 218.26 |
| LogP ≤ 5 | 0.56 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
Analyze 4-([1,2,4]triazolo[1,5-a]pyridin-2-ylmethyl)morpholine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 4-([1,2,4]triazolo[1,5-a]pyridin-2-ylmethyl)morpholine?
The IUPAC name of 4-([1,2,4]triazolo[1,5-a]pyridin-2-ylmethyl)morpholine (CID 117257528) is 4-([1,2,4]triazolo[1,5-a]pyridin-2-ylmethyl)morpholine.
What is the SMILES notation for 4-([1,2,4]triazolo[1,5-a]pyridin-2-ylmethyl)morpholine?
The canonical SMILES for 4-([1,2,4]triazolo[1,5-a]pyridin-2-ylmethyl)morpholine is c1ccn2nc(CN3CCOCC3)nc2c1.
What is the InChIKey of 4-([1,2,4]triazolo[1,5-a]pyridin-2-ylmethyl)morpholine?
The InChIKey is DGPFPFPKEFTZGU-UHFFFAOYSA-N. The full InChI is InChI=1S/C11H14N4O/c1-2-4-15-11(3-1)12-10(13-15)9-14-5-7-16-8-6-14/h1-4H,5-9H2.
What are the key properties of 4-([1,2,4]triazolo[1,5-a]pyridin-2-ylmethyl)morpholine?
4-([1,2,4]triazolo[1,5-a]pyridin-2-ylmethyl)morpholine has a molecular weight of 218.26 g/mol, XLogP of 0.56, 2 rotatable bonds, 0 hydrogen bond donors, and 5 hydrogen bond acceptors.
Where does this data come from?
All data for 4-([1,2,4]triazolo[1,5-a]pyridin-2-ylmethyl)morpholine is sourced from PubChem (CID 117257528), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).