C18H28O7 — CID 11725817
ethyl (E)-3-[(1S,2R,6R,7R,9R)-4-ethoxy-12,12-dimethyl-3,8,11,13-tetraoxatricyclo[7.4.0.02,6]tridecan-7-yl]prop-2-enoate (PubChem CID 11725817) has the molecular formula C18H28O7 and a molecular weight of 356.42 g/mol. Its IUPAC name is ethyl (E)-3-[(1S,2R,6R,7R,9R)-4-ethoxy-12,12-dimethyl-3,8,11,13-tetraoxatricyclo[7.4.0.02,6]tridecan-7-yl]prop-2-enoate.
| Compound Name | ethyl (E)-3-[(1S,2R,6R,7R,9R)-4-ethoxy-12,12-dimethyl-3,8,11,13-tetraoxatricyclo[7.4.0.02,6]tridecan-7-yl]prop-2-enoate |
|---|---|
| PubChem CID | 11725817 |
| Molecular Formula | C18H28O7 |
| Molecular Weight | 356.42 g/mol |
| Exact Mass | 356.18 |
| IUPAC Name | ethyl (E)-3-[(1S,2R,6R,7R,9R)-4-ethoxy-12,12-dimethyl-3,8,11,13-tetraoxatricyclo[7.4.0.02,6]tridecan-7-yl]prop-2-enoate |
| SMILES | CCOC(=O)/C=C/[C@H]1O[C@@H]2COC(C)(C)O[C@H]2[C@@H]2OC(OCC)C[C@@H]21 |
| InChI | InChI=1S/C18H28O7/c1-5-20-14(19)8-7-12-11-9-15(21-6-2)24-16(11)17-13(23-12)10-22-18(3,4)25-17/h7-8,11-13,15-17H,5-6,9-10H2,1-4H3/b8-7+/t11-,12-,13-,15?,16-,17-/m1/s1 |
| InChIKey | CRHBNTBBSOAQCL-CBJJABBPSA-N |
| XLogP | 1.79 |
| TPSA | 72.45 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 356.42 |
| LogP ≤ 5 | 1.79 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|