About 4-(5-chlorofuran-2-yl)-2,2-dimethylpiperidine
4-(5-chlorofuran-2-yl)-2,2-dimethylpiperidine (PubChem CID 117258206) has the molecular formula C11H16ClNO
and a molecular weight of 213.71 g/mol. Its IUPAC name is 4-(5-chlorofuran-2-yl)-2,2-dimethylpiperidine.
Molecular Properties
| Compound Name | 4-(5-chlorofuran-2-yl)-2,2-dimethylpiperidine |
| PubChem CID | 117258206 |
| Molecular Formula | C11H16ClNO |
| Molecular Weight | 213.71 g/mol |
| Exact Mass | 213.09 |
| IUPAC Name | 4-(5-chlorofuran-2-yl)-2,2-dimethylpiperidine |
| SMILES | CC1(C)CC(c2ccc(Cl)o2)CCN1 |
| InChI | InChI=1S/C11H16ClNO/c1-11(2)7-8(5-6-13-11)9-3-4-10(12)14-9/h3-4,8,13H,5-7H2,1-2H3 |
| InChIKey | VYICLBDHAVOOBD-UHFFFAOYSA-N |
| XLogP | 3.18 |
| TPSA | 25.17 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 14 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 213.71 |
| LogP ≤ 5 | 3.18 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
Analyze 4-(5-chlorofuran-2-yl)-2,2-dimethylpiperidine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 4-(5-chlorofuran-2-yl)-2,2-dimethylpiperidine?
The IUPAC name of 4-(5-chlorofuran-2-yl)-2,2-dimethylpiperidine (CID 117258206) is 4-(5-chlorofuran-2-yl)-2,2-dimethylpiperidine.
What is the SMILES notation for 4-(5-chlorofuran-2-yl)-2,2-dimethylpiperidine?
The canonical SMILES for 4-(5-chlorofuran-2-yl)-2,2-dimethylpiperidine is CC1(C)CC(c2ccc(Cl)o2)CCN1.
What is the InChIKey of 4-(5-chlorofuran-2-yl)-2,2-dimethylpiperidine?
The InChIKey is VYICLBDHAVOOBD-UHFFFAOYSA-N. The full InChI is InChI=1S/C11H16ClNO/c1-11(2)7-8(5-6-13-11)9-3-4-10(12)14-9/h3-4,8,13H,5-7H2,1-2H3.
What are the key properties of 4-(5-chlorofuran-2-yl)-2,2-dimethylpiperidine?
4-(5-chlorofuran-2-yl)-2,2-dimethylpiperidine has a molecular weight of 213.71 g/mol, XLogP of 3.18, 1 rotatable bonds, 1 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for 4-(5-chlorofuran-2-yl)-2,2-dimethylpiperidine is sourced from PubChem (CID 117258206), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).