C10H8Cl2N2OS — CID 117258710
[4-chloro-2-(2-chlorophenoxy)-1,3-thiazol-5-yl]methanamine (PubChem CID 117258710) has the molecular formula C10H8Cl2N2OS and a molecular weight of 275.16 g/mol. Its IUPAC name is [4-chloro-2-(2-chlorophenoxy)-1,3-thiazol-5-yl]methanamine.
| Compound Name | [4-chloro-2-(2-chlorophenoxy)-1,3-thiazol-5-yl]methanamine |
|---|---|
| PubChem CID | 117258710 |
| Molecular Formula | C10H8Cl2N2OS |
| Molecular Weight | 275.16 g/mol |
| Exact Mass | 273.97 |
| IUPAC Name | [4-chloro-2-(2-chlorophenoxy)-1,3-thiazol-5-yl]methanamine |
| SMILES | NCc1sc(Oc2ccccc2Cl)nc1Cl |
| InChI | InChI=1S/C10H8Cl2N2OS/c11-6-3-1-2-4-7(6)15-10-14-9(12)8(5-13)16-10/h1-4H,5,13H2 |
| InChIKey | WJEJVSALOUTOPA-UHFFFAOYSA-N |
| XLogP | 3.70 |
| TPSA | 48.14 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 275.16 |
| LogP ≤ 5 | 3.70 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |