4-bromo-2-methoxy-1,3-thiazole-5-carboxylic acid

C5H4BrNO3S — CID 117258762

IUPAC4-bromo-2-methoxy-1,3-thiazole-5-carboxylic acid
SMILESCOc1nc(Br)c(C(=O)O)s1
InChIInChI=1S/C5H4BrNO3S/c1-10-5-7-3(6)2(11-5)4(8)9/h1H3,(H,8,9)
InChIKeyNTVBUBUIEXBHDK-UHFFFAOYSA-N
MW238.06 g/mol
LogP1.61
Rot. Bonds2

About 4-bromo-2-methoxy-1,3-thiazole-5-carboxylic acid

4-bromo-2-methoxy-1,3-thiazole-5-carboxylic acid (PubChem CID 117258762) has the molecular formula C5H4BrNO3S and a molecular weight of 238.06 g/mol. Its IUPAC name is 4-bromo-2-methoxy-1,3-thiazole-5-carboxylic acid.

Molecular Properties

Compound Name4-bromo-2-methoxy-1,3-thiazole-5-carboxylic acid
PubChem CID117258762
Molecular FormulaC5H4BrNO3S
Molecular Weight238.06 g/mol
Exact Mass236.91
IUPAC Name4-bromo-2-methoxy-1,3-thiazole-5-carboxylic acid
SMILESCOc1nc(Br)c(C(=O)O)s1
InChIInChI=1S/C5H4BrNO3S/c1-10-5-7-3(6)2(11-5)4(8)9/h1H3,(H,8,9)
InChIKeyNTVBUBUIEXBHDK-UHFFFAOYSA-N
XLogP1.61
TPSA59.42 Ų
H-Bond Donors1
H-Bond Acceptors4
Rotatable Bonds2
Heavy Atoms11
Complexity—

Lipinski Rule of Five

Passes Rule of Five

RuleValue
MW ≤ 500238.06
LogP ≤ 51.61
H-Bond Donors ≤ 51
H-Bond Acceptors ≤ 104

Analyze 4-bromo-2-methoxy-1,3-thiazole-5-carboxylic acid with MolForge

Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.

Launch Full Analysis

Frequently Asked Questions

What is the IUPAC name of 4-bromo-2-methoxy-1,3-thiazole-5-carboxylic acid?
The IUPAC name of 4-bromo-2-methoxy-1,3-thiazole-5-carboxylic acid (CID 117258762) is 4-bromo-2-methoxy-1,3-thiazole-5-carboxylic acid.
What is the SMILES notation for 4-bromo-2-methoxy-1,3-thiazole-5-carboxylic acid?
The canonical SMILES for 4-bromo-2-methoxy-1,3-thiazole-5-carboxylic acid is COc1nc(Br)c(C(=O)O)s1.
What is the InChIKey of 4-bromo-2-methoxy-1,3-thiazole-5-carboxylic acid?
The InChIKey is NTVBUBUIEXBHDK-UHFFFAOYSA-N. The full InChI is InChI=1S/C5H4BrNO3S/c1-10-5-7-3(6)2(11-5)4(8)9/h1H3,(H,8,9).
What are the key properties of 4-bromo-2-methoxy-1,3-thiazole-5-carboxylic acid?
4-bromo-2-methoxy-1,3-thiazole-5-carboxylic acid has a molecular weight of 238.06 g/mol, XLogP of 1.61, 2 rotatable bonds, 1 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for 4-bromo-2-methoxy-1,3-thiazole-5-carboxylic acid is sourced from PubChem (CID 117258762), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).