About 5-chloro-2-piperidin-4-yl-1,3-oxazole
5-chloro-2-piperidin-4-yl-1,3-oxazole (PubChem CID 117258851) has the molecular formula C8H11ClN2O
and a molecular weight of 186.64 g/mol. Its IUPAC name is 5-chloro-2-piperidin-4-yl-1,3-oxazole.
Molecular Properties
| Compound Name | 5-chloro-2-piperidin-4-yl-1,3-oxazole |
| PubChem CID | 117258851 |
| Molecular Formula | C8H11ClN2O |
| Molecular Weight | 186.64 g/mol |
| Exact Mass | 186.06 |
| IUPAC Name | 5-chloro-2-piperidin-4-yl-1,3-oxazole |
| SMILES | Clc1cnc(C2CCNCC2)o1 |
| InChI | InChI=1S/C8H11ClN2O/c9-7-5-11-8(12-7)6-1-3-10-4-2-6/h5-6,10H,1-4H2 |
| InChIKey | IPPJNSYNXBORMZ-UHFFFAOYSA-N |
| XLogP | 1.79 |
| TPSA | 38.06 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 12 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 186.64 |
| LogP ≤ 5 | 1.79 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
Analyze 5-chloro-2-piperidin-4-yl-1,3-oxazole with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 5-chloro-2-piperidin-4-yl-1,3-oxazole?
The IUPAC name of 5-chloro-2-piperidin-4-yl-1,3-oxazole (CID 117258851) is 5-chloro-2-piperidin-4-yl-1,3-oxazole.
What is the SMILES notation for 5-chloro-2-piperidin-4-yl-1,3-oxazole?
The canonical SMILES for 5-chloro-2-piperidin-4-yl-1,3-oxazole is Clc1cnc(C2CCNCC2)o1.
What is the InChIKey of 5-chloro-2-piperidin-4-yl-1,3-oxazole?
The InChIKey is IPPJNSYNXBORMZ-UHFFFAOYSA-N. The full InChI is InChI=1S/C8H11ClN2O/c9-7-5-11-8(12-7)6-1-3-10-4-2-6/h5-6,10H,1-4H2.
What are the key properties of 5-chloro-2-piperidin-4-yl-1,3-oxazole?
5-chloro-2-piperidin-4-yl-1,3-oxazole has a molecular weight of 186.64 g/mol, XLogP of 1.79, 1 rotatable bonds, 1 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for 5-chloro-2-piperidin-4-yl-1,3-oxazole is sourced from PubChem (CID 117258851), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).