About 5-chloro-2-cyclopropyl-1,3-thiazole
5-chloro-2-cyclopropyl-1,3-thiazole (PubChem CID 117259109) has the molecular formula C6H6ClNS
and a molecular weight of 159.64 g/mol. Its IUPAC name is 5-chloro-2-cyclopropyl-1,3-thiazole.
Molecular Properties
| Compound Name | 5-chloro-2-cyclopropyl-1,3-thiazole |
| PubChem CID | 117259109 |
| Molecular Formula | C6H6ClNS |
| Molecular Weight | 159.64 g/mol |
| Exact Mass | 158.99 |
| IUPAC Name | 5-chloro-2-cyclopropyl-1,3-thiazole |
| SMILES | Clc1cnc(C2CC2)s1 |
| InChI | InChI=1S/C6H6ClNS/c7-5-3-8-6(9-5)4-1-2-4/h3-4H,1-2H2 |
| InChIKey | MSRAAGZVLNNSMV-UHFFFAOYSA-N |
| XLogP | 2.67 |
| TPSA | 12.89 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 9 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 159.64 |
| LogP ≤ 5 | 2.67 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
Analyze 5-chloro-2-cyclopropyl-1,3-thiazole with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 5-chloro-2-cyclopropyl-1,3-thiazole?
The IUPAC name of 5-chloro-2-cyclopropyl-1,3-thiazole (CID 117259109) is 5-chloro-2-cyclopropyl-1,3-thiazole.
What is the SMILES notation for 5-chloro-2-cyclopropyl-1,3-thiazole?
The canonical SMILES for 5-chloro-2-cyclopropyl-1,3-thiazole is Clc1cnc(C2CC2)s1.
What is the InChIKey of 5-chloro-2-cyclopropyl-1,3-thiazole?
The InChIKey is MSRAAGZVLNNSMV-UHFFFAOYSA-N. The full InChI is InChI=1S/C6H6ClNS/c7-5-3-8-6(9-5)4-1-2-4/h3-4H,1-2H2.
What are the key properties of 5-chloro-2-cyclopropyl-1,3-thiazole?
5-chloro-2-cyclopropyl-1,3-thiazole has a molecular weight of 159.64 g/mol, XLogP of 2.67, 1 rotatable bonds, 0 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for 5-chloro-2-cyclopropyl-1,3-thiazole is sourced from PubChem (CID 117259109), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).