C20H26N2O2S — CID 11725960
N-[4-[(E)-2-(3,5-ditert-butyl-4-hydroxyphenyl)ethenyl]-1,3-thiazol-2-yl]formamide (PubChem CID 11725960) has the molecular formula C20H26N2O2S and a molecular weight of 358.51 g/mol. Its IUPAC name is N-[4-[(E)-2-(3,5-ditert-butyl-4-hydroxyphenyl)ethenyl]-1,3-thiazol-2-yl]formamide.
| Compound Name | N-[4-[(E)-2-(3,5-ditert-butyl-4-hydroxyphenyl)ethenyl]-1,3-thiazol-2-yl]formamide |
|---|---|
| PubChem CID | 11725960 |
| Molecular Formula | C20H26N2O2S |
| Molecular Weight | 358.51 g/mol |
| Exact Mass | 358.17 |
| IUPAC Name | N-[4-[(E)-2-(3,5-ditert-butyl-4-hydroxyphenyl)ethenyl]-1,3-thiazol-2-yl]formamide |
| SMILES | CC(C)(C)c1cc(/C=C/c2csc(NC=O)n2)cc(C(C)(C)C)c1O |
| InChI | InChI=1S/C20H26N2O2S/c1-19(2,3)15-9-13(10-16(17(15)24)20(4,5)6)7-8-14-11-25-18(22-14)21-12-23/h7-12,24H,1-6H3,(H,21,22,23)/b8-7+ |
| InChIKey | HZAQSLHDKHPYHV-BQYQJAHWSA-N |
| XLogP | 5.18 |
| TPSA | 62.22 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 25 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 358.51 |
| LogP ≤ 5 | 5.18 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'} |
|---|