About 4-(5-chloro-1,3-oxazol-2-yl)morpholine
4-(5-chloro-1,3-oxazol-2-yl)morpholine (PubChem CID 117260213) has the molecular formula C7H9ClN2O2
and a molecular weight of 188.61 g/mol. Its IUPAC name is 4-(5-chloro-1,3-oxazol-2-yl)morpholine.
Molecular Properties
| Compound Name | 4-(5-chloro-1,3-oxazol-2-yl)morpholine |
| PubChem CID | 117260213 |
| Molecular Formula | C7H9ClN2O2 |
| Molecular Weight | 188.61 g/mol |
| Exact Mass | 188.04 |
| IUPAC Name | 4-(5-chloro-1,3-oxazol-2-yl)morpholine |
| SMILES | Clc1cnc(N2CCOCC2)o1 |
| InChI | InChI=1S/C7H9ClN2O2/c8-6-5-9-7(12-6)10-1-3-11-4-2-10/h5H,1-4H2 |
| InChIKey | YQUPBJSIYJBZOQ-UHFFFAOYSA-N |
| XLogP | 1.16 |
| TPSA | 38.50 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 12 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 188.61 |
| LogP ≤ 5 | 1.16 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
Analyze 4-(5-chloro-1,3-oxazol-2-yl)morpholine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 4-(5-chloro-1,3-oxazol-2-yl)morpholine?
The IUPAC name of 4-(5-chloro-1,3-oxazol-2-yl)morpholine (CID 117260213) is 4-(5-chloro-1,3-oxazol-2-yl)morpholine.
What is the SMILES notation for 4-(5-chloro-1,3-oxazol-2-yl)morpholine?
The canonical SMILES for 4-(5-chloro-1,3-oxazol-2-yl)morpholine is Clc1cnc(N2CCOCC2)o1.
What is the InChIKey of 4-(5-chloro-1,3-oxazol-2-yl)morpholine?
The InChIKey is YQUPBJSIYJBZOQ-UHFFFAOYSA-N. The full InChI is InChI=1S/C7H9ClN2O2/c8-6-5-9-7(12-6)10-1-3-11-4-2-10/h5H,1-4H2.
What are the key properties of 4-(5-chloro-1,3-oxazol-2-yl)morpholine?
4-(5-chloro-1,3-oxazol-2-yl)morpholine has a molecular weight of 188.61 g/mol, XLogP of 1.16, 1 rotatable bonds, 0 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for 4-(5-chloro-1,3-oxazol-2-yl)morpholine is sourced from PubChem (CID 117260213), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).