About 6-[(4,6-diphenyl-2-pyridinyl)oxy]hexanamide
6-[(4,6-diphenyl-2-pyridinyl)oxy]hexanamide (PubChem CID 11726048) has the molecular formula C23H24N2O2
and a molecular weight of 360.46 g/mol. Its IUPAC name is 6-[(4,6-diphenyl-2-pyridinyl)oxy]hexanamide.
Molecular Properties
| Compound Name | 6-[(4,6-diphenyl-2-pyridinyl)oxy]hexanamide |
| PubChem CID | 11726048 |
| Molecular Formula | C23H24N2O2 |
| Molecular Weight | 360.46 g/mol |
| Exact Mass | 360.18 |
| IUPAC Name | 6-[(4,6-diphenyl-2-pyridinyl)oxy]hexanamide |
| SMILES | NC(=O)CCCCCOc1cc(-c2ccccc2)cc(-c2ccccc2)n1 |
| InChI | InChI=1S/C23H24N2O2/c24-22(26)14-8-3-9-15-27-23-17-20(18-10-4-1-5-11-18)16-21(25-23)19-12-6-2-7-13-19/h1-2,4-7,10-13,16-17H,3,8-9,14-15H2,(H2,24,26) |
| InChIKey | TWPWFLNKGCYTGP-UHFFFAOYSA-N |
| XLogP | 4.84 |
| TPSA | 65.21 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 27 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 360.46 |
| LogP ≤ 5 | 4.84 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|
Analyze 6-[(4,6-diphenyl-2-pyridinyl)oxy]hexanamide with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 6-[(4,6-diphenyl-2-pyridinyl)oxy]hexanamide?
The IUPAC name of 6-[(4,6-diphenyl-2-pyridinyl)oxy]hexanamide (CID 11726048) is 6-[(4,6-diphenyl-2-pyridinyl)oxy]hexanamide.
What is the SMILES notation for 6-[(4,6-diphenyl-2-pyridinyl)oxy]hexanamide?
The canonical SMILES for 6-[(4,6-diphenyl-2-pyridinyl)oxy]hexanamide is NC(=O)CCCCCOc1cc(-c2ccccc2)cc(-c2ccccc2)n1.
What is the InChIKey of 6-[(4,6-diphenyl-2-pyridinyl)oxy]hexanamide?
The InChIKey is TWPWFLNKGCYTGP-UHFFFAOYSA-N. The full InChI is InChI=1S/C23H24N2O2/c24-22(26)14-8-3-9-15-27-23-17-20(18-10-4-1-5-11-18)16-21(25-23)19-12-6-2-7-13-19/h1-2,4-7,10-13,16-17H,3,8-9,14-15H2,(H2,24,26).
What are the key properties of 6-[(4,6-diphenyl-2-pyridinyl)oxy]hexanamide?
6-[(4,6-diphenyl-2-pyridinyl)oxy]hexanamide has a molecular weight of 360.46 g/mol, XLogP of 4.84, 9 rotatable bonds, 1 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for 6-[(4,6-diphenyl-2-pyridinyl)oxy]hexanamide is sourced from PubChem (CID 11726048), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).