About N-butyl-2,4-dimethyl-N-(8-methyl-8-azabicyclo[3.2.1]oct-2-en-3-yl)benzamide;hydrochloride
N-butyl-2,4-dimethyl-N-(8-methyl-8-azabicyclo[3.2.1]oct-2-en-3-yl)benzamide;hydrochloride (PubChem CID 11726191) has the molecular formula C21H31ClN2O
and a molecular weight of 362.95 g/mol. Its IUPAC name is N-butyl-2,4-dimethyl-N-(8-methyl-8-azabicyclo[3.2.1]oct-2-en-3-yl)benzamide;hydrochloride.
Molecular Properties
| Compound Name | N-butyl-2,4-dimethyl-N-(8-methyl-8-azabicyclo[3.2.1]oct-2-en-3-yl)benzamide;hydrochloride |
| PubChem CID | 11726191 |
| Molecular Formula | C21H31ClN2O |
| Molecular Weight | 362.95 g/mol |
| Exact Mass | 362.21 |
| IUPAC Name | N-butyl-2,4-dimethyl-N-(8-methyl-8-azabicyclo[3.2.1]oct-2-en-3-yl)benzamide;hydrochloride |
| SMILES | CCCCN(C(=O)c1ccc(C)cc1C)C1=CC2CCC(C1)N2C.Cl |
| InChI | InChI=1S/C21H30N2O.ClH/c1-5-6-11-23(19-13-17-8-9-18(14-19)22(17)4)21(24)20-10-7-15(2)12-16(20)3;/h7,10,12-13,17-18H,5-6,8-9,11,14H2,1-4H3;1H |
| InChIKey | JLZDFPQSZLZDGL-UHFFFAOYSA-N |
| XLogP | 4.72 |
| TPSA | 23.55 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 25 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 362.95 |
| LogP ≤ 5 | 4.72 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
Analyze N-butyl-2,4-dimethyl-N-(8-methyl-8-azabicyclo[3.2.1]oct-2-en-3-yl)benzamide;hydrochloride with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of N-butyl-2,4-dimethyl-N-(8-methyl-8-azabicyclo[3.2.1]oct-2-en-3-yl)benzamide;hydrochloride?
The IUPAC name of N-butyl-2,4-dimethyl-N-(8-methyl-8-azabicyclo[3.2.1]oct-2-en-3-yl)benzamide;hydrochloride (CID 11726191) is N-butyl-2,4-dimethyl-N-(8-methyl-8-azabicyclo[3.2.1]oct-2-en-3-yl)benzamide;hydrochloride.
What is the SMILES notation for N-butyl-2,4-dimethyl-N-(8-methyl-8-azabicyclo[3.2.1]oct-2-en-3-yl)benzamide;hydrochloride?
The canonical SMILES for N-butyl-2,4-dimethyl-N-(8-methyl-8-azabicyclo[3.2.1]oct-2-en-3-yl)benzamide;hydrochloride is CCCCN(C(=O)c1ccc(C)cc1C)C1=CC2CCC(C1)N2C.Cl.
What is the InChIKey of N-butyl-2,4-dimethyl-N-(8-methyl-8-azabicyclo[3.2.1]oct-2-en-3-yl)benzamide;hydrochloride?
The InChIKey is JLZDFPQSZLZDGL-UHFFFAOYSA-N. The full InChI is InChI=1S/C21H30N2O.ClH/c1-5-6-11-23(19-13-17-8-9-18(14-19)22(17)4)21(24)20-10-7-15(2)12-16(20)3;/h7,10,12-13,17-18H,5-6,8-9,11,14H2,1-4H3;1H.
What are the key properties of N-butyl-2,4-dimethyl-N-(8-methyl-8-azabicyclo[3.2.1]oct-2-en-3-yl)benzamide;hydrochloride?
N-butyl-2,4-dimethyl-N-(8-methyl-8-azabicyclo[3.2.1]oct-2-en-3-yl)benzamide;hydrochloride has a molecular weight of 362.95 g/mol, XLogP of 4.72, 5 rotatable bonds, 0 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for N-butyl-2,4-dimethyl-N-(8-methyl-8-azabicyclo[3.2.1]oct-2-en-3-yl)benzamide;hydrochloride is sourced from PubChem (CID 11726191), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).