C15H19N3O2 — CID 117262886
7-methyl-3-(piperidin-3-ylmethyl)-1H-quinazoline-2,4-dione (PubChem CID 117262886) has the molecular formula C15H19N3O2 and a molecular weight of 273.34 g/mol. Its IUPAC name is 7-methyl-3-(piperidin-3-ylmethyl)-1H-quinazoline-2,4-dione.
| Compound Name | 7-methyl-3-(piperidin-3-ylmethyl)-1H-quinazoline-2,4-dione |
|---|---|
| PubChem CID | 117262886 |
| Molecular Formula | C15H19N3O2 |
| Molecular Weight | 273.34 g/mol |
| Exact Mass | 273.15 |
| IUPAC Name | 7-methyl-3-(piperidin-3-ylmethyl)-1H-quinazoline-2,4-dione |
| SMILES | Cc1ccc2c(=O)n(CC3CCCNC3)c(=O)[nH]c2c1 |
| InChI | InChI=1S/C15H19N3O2/c1-10-4-5-12-13(7-10)17-15(20)18(14(12)19)9-11-3-2-6-16-8-11/h4-5,7,11,16H,2-3,6,8-9H2,1H3,(H,17,20) |
| InChIKey | XQWGVAYAMJNSEH-UHFFFAOYSA-N |
| XLogP | 1.00 |
| TPSA | 66.89 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 273.34 |
| LogP ≤ 5 | 1.00 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |