C20H28O4S — CID 11726303
(1S,3aR,4S,6S,8aR)-1-(2-methoxyethoxymethoxy)-6-phenylsulfanyl-1,2,3,3a,4,5,6,8a-octahydroazulen-4-ol (PubChem CID 11726303) has the molecular formula C20H28O4S and a molecular weight of 364.51 g/mol. Its IUPAC name is (1S,3aR,4S,6S,8aR)-1-(2-methoxyethoxymethoxy)-6-phenylsulfanyl-1,2,3,3a,4,5,6,8a-octahydroazulen-4-ol.
| Compound Name | (1S,3aR,4S,6S,8aR)-1-(2-methoxyethoxymethoxy)-6-phenylsulfanyl-1,2,3,3a,4,5,6,8a-octahydroazulen-4-ol |
|---|---|
| PubChem CID | 11726303 |
| Molecular Formula | C20H28O4S |
| Molecular Weight | 364.51 g/mol |
| Exact Mass | 364.17 |
| IUPAC Name | (1S,3aR,4S,6S,8aR)-1-(2-methoxyethoxymethoxy)-6-phenylsulfanyl-1,2,3,3a,4,5,6,8a-octahydroazulen-4-ol |
| SMILES | COCCOCO[C@H]1CC[C@@H]2[C@H]1C=C[C@@H](Sc1ccccc1)C[C@@H]2O |
| InChI | InChI=1S/C20H28O4S/c1-22-11-12-23-14-24-20-10-9-17-18(20)8-7-16(13-19(17)21)25-15-5-3-2-4-6-15/h2-8,16-21H,9-14H2,1H3/t16-,17-,18-,19+,20+/m1/s1 |
| InChIKey | DYGWZRATGNXXFY-UEDWAMCQSA-N |
| XLogP | 3.50 |
| TPSA | 47.92 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 364.51 |
| LogP ≤ 5 | 3.50 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|