C22H28NO2P — CID 11726581
(2S,3aR)-2-[(1S)-1-diphenylphosphorylpropyl]-3,3a,4,5,6,7-hexahydro-2H-[1,2]oxazolo[2,3-a]pyridine (PubChem CID 11726581) has the molecular formula C22H28NO2P and a molecular weight of 369.44 g/mol. Its IUPAC name is (2S,3aR)-2-[(1S)-1-diphenylphosphorylpropyl]-3,3a,4,5,6,7-hexahydro-2H-[1,2]oxazolo[2,3-a]pyridine.
| Compound Name | (2S,3aR)-2-[(1S)-1-diphenylphosphorylpropyl]-3,3a,4,5,6,7-hexahydro-2H-[1,2]oxazolo[2,3-a]pyridine |
|---|---|
| PubChem CID | 11726581 |
| Molecular Formula | C22H28NO2P |
| Molecular Weight | 369.44 g/mol |
| Exact Mass | 369.19 |
| IUPAC Name | (2S,3aR)-2-[(1S)-1-diphenylphosphorylpropyl]-3,3a,4,5,6,7-hexahydro-2H-[1,2]oxazolo[2,3-a]pyridine |
| SMILES | CC[C@@H]([C@@H]1C[C@H]2CCCCN2O1)P(=O)(c1ccccc1)c1ccccc1 |
| InChI | InChI=1S/C22H28NO2P/c1-2-22(21-17-18-11-9-10-16-23(18)25-21)26(24,19-12-5-3-6-13-19)20-14-7-4-8-15-20/h3-8,12-15,18,21-22H,2,9-11,16-17H2,1H3/t18-,21+,22+/m1/s1 |
| InChIKey | AJYLHOYGKSNELO-COPCDDAFSA-N |
| XLogP | 4.34 |
| TPSA | 29.54 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 369.44 |
| LogP ≤ 5 | 4.34 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|