About 2-(oxan-4-yl)prop-2-enal
2-(oxan-4-yl)prop-2-enal (PubChem CID 117266747) has the molecular formula C8H12O2
and a molecular weight of 140.18 g/mol. Its IUPAC name is 2-(oxan-4-yl)prop-2-enal.
Molecular Properties
| Compound Name | 2-(oxan-4-yl)prop-2-enal |
| PubChem CID | 117266747 |
| Molecular Formula | C8H12O2 |
| Molecular Weight | 140.18 g/mol |
| Exact Mass | 140.08 |
| IUPAC Name | 2-(oxan-4-yl)prop-2-enal |
| SMILES | C=C(C=O)C1CCOCC1 |
| InChI | InChI=1S/C8H12O2/c1-7(6-9)8-2-4-10-5-3-8/h6,8H,1-5H2 |
| InChIKey | DZZFDDICNRLHCT-UHFFFAOYSA-N |
| XLogP | 1.17 |
| TPSA | 26.30 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 10 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 140.18 |
| LogP ≤ 5 | 1.17 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|
Analyze 2-(oxan-4-yl)prop-2-enal with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2-(oxan-4-yl)prop-2-enal?
The IUPAC name of 2-(oxan-4-yl)prop-2-enal (CID 117266747) is 2-(oxan-4-yl)prop-2-enal.
What is the SMILES notation for 2-(oxan-4-yl)prop-2-enal?
The canonical SMILES for 2-(oxan-4-yl)prop-2-enal is C=C(C=O)C1CCOCC1.
What is the InChIKey of 2-(oxan-4-yl)prop-2-enal?
The InChIKey is DZZFDDICNRLHCT-UHFFFAOYSA-N. The full InChI is InChI=1S/C8H12O2/c1-7(6-9)8-2-4-10-5-3-8/h6,8H,1-5H2.
What are the key properties of 2-(oxan-4-yl)prop-2-enal?
2-(oxan-4-yl)prop-2-enal has a molecular weight of 140.18 g/mol, XLogP of 1.17, 2 rotatable bonds, 0 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for 2-(oxan-4-yl)prop-2-enal is sourced from PubChem (CID 117266747), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).