methyl 2-[(1,1-dioxothian-4-yl)methyl]prop-2-enoate

C10H16O4S — CID 117266883

IUPACmethyl 2-[(1,1-dioxothian-4-yl)methyl]prop-2-enoate
SMILESC=C(CC1CCS(=O)(=O)CC1)C(=O)OC
InChIInChI=1S/C10H16O4S/c1-8(10(11)14-2)7-9-3-5-15(12,13)6-4-9/h9H,1,3-7H2,2H3
InChIKeyVRKUZTJMGGOHLO-UHFFFAOYSA-N
MW232.30 g/mol
LogP0.93
Rot. Bonds3

About methyl 2-[(1,1-dioxothian-4-yl)methyl]prop-2-enoate

methyl 2-[(1,1-dioxothian-4-yl)methyl]prop-2-enoate (PubChem CID 117266883) has the molecular formula C10H16O4S and a molecular weight of 232.30 g/mol. Its IUPAC name is methyl 2-[(1,1-dioxothian-4-yl)methyl]prop-2-enoate.

Molecular Properties

Compound Namemethyl 2-[(1,1-dioxothian-4-yl)methyl]prop-2-enoate
PubChem CID117266883
Molecular FormulaC10H16O4S
Molecular Weight232.30 g/mol
Exact Mass232.08
IUPAC Namemethyl 2-[(1,1-dioxothian-4-yl)methyl]prop-2-enoate
SMILESC=C(CC1CCS(=O)(=O)CC1)C(=O)OC
InChIInChI=1S/C10H16O4S/c1-8(10(11)14-2)7-9-3-5-15(12,13)6-4-9/h9H,1,3-7H2,2H3
InChIKeyVRKUZTJMGGOHLO-UHFFFAOYSA-N
XLogP0.93
TPSA60.44 Ų
H-Bond Donors
H-Bond Acceptors4
Rotatable Bonds3
Heavy Atoms15
Complexity

Lipinski Rule of Five

Passes Rule of Five

RuleValue
MW ≤ 500232.30
LogP ≤ 50.93
H-Bond Donors ≤ 50
H-Bond Acceptors ≤ 104

Computed Properties (RDKit)

Structural Alerts{'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}

Analyze methyl 2-[(1,1-dioxothian-4-yl)methyl]prop-2-enoate with MolForge

Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.

Launch Full Analysis

Frequently Asked Questions

What is the IUPAC name of methyl 2-[(1,1-dioxothian-4-yl)methyl]prop-2-enoate?
The IUPAC name of methyl 2-[(1,1-dioxothian-4-yl)methyl]prop-2-enoate (CID 117266883) is methyl 2-[(1,1-dioxothian-4-yl)methyl]prop-2-enoate.
What is the SMILES notation for methyl 2-[(1,1-dioxothian-4-yl)methyl]prop-2-enoate?
The canonical SMILES for methyl 2-[(1,1-dioxothian-4-yl)methyl]prop-2-enoate is C=C(CC1CCS(=O)(=O)CC1)C(=O)OC.
What is the InChIKey of methyl 2-[(1,1-dioxothian-4-yl)methyl]prop-2-enoate?
The InChIKey is VRKUZTJMGGOHLO-UHFFFAOYSA-N. The full InChI is InChI=1S/C10H16O4S/c1-8(10(11)14-2)7-9-3-5-15(12,13)6-4-9/h9H,1,3-7H2,2H3.
What are the key properties of methyl 2-[(1,1-dioxothian-4-yl)methyl]prop-2-enoate?
methyl 2-[(1,1-dioxothian-4-yl)methyl]prop-2-enoate has a molecular weight of 232.30 g/mol, XLogP of 0.93, 3 rotatable bonds, 0 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for methyl 2-[(1,1-dioxothian-4-yl)methyl]prop-2-enoate is sourced from PubChem (CID 117266883), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).