(Z)-5-(1,1-dioxothian-4-yl)pent-3-enoic acid

C10H16O4S — CID 117267485

IUPAC(Z)-5-(1,1-dioxothian-4-yl)pent-3-enoic acid
SMILESO=C(O)C/C=C\CC1CCS(=O)(=O)CC1
InChIInChI=1S/C10H16O4S/c11-10(12)4-2-1-3-9-5-7-15(13,14)8-6-9/h1-2,9H,3-8H2,(H,11,12)/b2-1-
InChIKeyWOOWSWLNRYFYCX-UPHRSURJSA-N
MW232.30 g/mol
LogP1.23
Rot. Bonds4

About (Z)-5-(1,1-dioxothian-4-yl)pent-3-enoic acid

(Z)-5-(1,1-dioxothian-4-yl)pent-3-enoic acid (PubChem CID 117267485) has the molecular formula C10H16O4S and a molecular weight of 232.30 g/mol. Its IUPAC name is (Z)-5-(1,1-dioxothian-4-yl)pent-3-enoic acid.

Molecular Properties

Compound Name(Z)-5-(1,1-dioxothian-4-yl)pent-3-enoic acid
PubChem CID117267485
Molecular FormulaC10H16O4S
Molecular Weight232.30 g/mol
Exact Mass232.08
IUPAC Name(Z)-5-(1,1-dioxothian-4-yl)pent-3-enoic acid
SMILESO=C(O)C/C=C\CC1CCS(=O)(=O)CC1
InChIInChI=1S/C10H16O4S/c11-10(12)4-2-1-3-9-5-7-15(13,14)8-6-9/h1-2,9H,3-8H2,(H,11,12)/b2-1-
InChIKeyWOOWSWLNRYFYCX-UPHRSURJSA-N
XLogP1.23
TPSA71.44 Ų
H-Bond Donors1
H-Bond Acceptors3
Rotatable Bonds4
Heavy Atoms15
Complexity—

Lipinski Rule of Five

Passes Rule of Five

RuleValue
MW ≤ 500232.30
LogP ≤ 51.23
H-Bond Donors ≤ 51
H-Bond Acceptors ≤ 103

Computed Properties (RDKit)

Structural Alerts{'alert_name': 'isolated_alkene', 'substructure': 'N/A'}

Analyze (Z)-5-(1,1-dioxothian-4-yl)pent-3-enoic acid with MolForge

Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.

Launch Full Analysis

Frequently Asked Questions

What is the IUPAC name of (Z)-5-(1,1-dioxothian-4-yl)pent-3-enoic acid?
The IUPAC name of (Z)-5-(1,1-dioxothian-4-yl)pent-3-enoic acid (CID 117267485) is (Z)-5-(1,1-dioxothian-4-yl)pent-3-enoic acid.
What is the SMILES notation for (Z)-5-(1,1-dioxothian-4-yl)pent-3-enoic acid?
The canonical SMILES for (Z)-5-(1,1-dioxothian-4-yl)pent-3-enoic acid is O=C(O)C/C=C\CC1CCS(=O)(=O)CC1.
What is the InChIKey of (Z)-5-(1,1-dioxothian-4-yl)pent-3-enoic acid?
The InChIKey is WOOWSWLNRYFYCX-UPHRSURJSA-N. The full InChI is InChI=1S/C10H16O4S/c11-10(12)4-2-1-3-9-5-7-15(13,14)8-6-9/h1-2,9H,3-8H2,(H,11,12)/b2-1-.
What are the key properties of (Z)-5-(1,1-dioxothian-4-yl)pent-3-enoic acid?
(Z)-5-(1,1-dioxothian-4-yl)pent-3-enoic acid has a molecular weight of 232.30 g/mol, XLogP of 1.23, 4 rotatable bonds, 1 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for (Z)-5-(1,1-dioxothian-4-yl)pent-3-enoic acid is sourced from PubChem (CID 117267485), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).