C9H14O3S — CID 117267526
(Z)-4-(1,1-dioxothian-3-yl)but-3-enal (PubChem CID 117267526) has the molecular formula C9H14O3S and a molecular weight of 202.27 g/mol. Its IUPAC name is (Z)-4-(1,1-dioxothian-3-yl)but-3-enal.
| Compound Name | (Z)-4-(1,1-dioxothian-3-yl)but-3-enal |
|---|---|
| PubChem CID | 117267526 |
| Molecular Formula | C9H14O3S |
| Molecular Weight | 202.27 g/mol |
| Exact Mass | 202.07 |
| IUPAC Name | (Z)-4-(1,1-dioxothian-3-yl)but-3-enal |
| SMILES | O=CC/C=C\C1CCCS(=O)(=O)C1 |
| InChI | InChI=1S/C9H14O3S/c10-6-2-1-4-9-5-3-7-13(11,12)8-9/h1,4,6,9H,2-3,5,7-8H2/b4-1- |
| InChIKey | PWPRJXVRWGNOTI-RJRFIUFISA-N |
| XLogP | 0.96 |
| TPSA | 51.21 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 13 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 202.27 |
| LogP ≤ 5 | 0.96 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|