About 3,7-dibromoazulene-1,5-dione
3,7-dibromoazulene-1,5-dione (PubChem CID 11726819) has the molecular formula C10H4Br2O2
and a molecular weight of 315.95 g/mol. Its IUPAC name is 3,7-dibromoazulene-1,5-dione.
Molecular Properties
| Compound Name | 3,7-dibromoazulene-1,5-dione |
| PubChem CID | 11726819 |
| Molecular Formula | C10H4Br2O2 |
| Molecular Weight | 315.95 g/mol |
| Exact Mass | 313.86 |
| IUPAC Name | 3,7-dibromoazulene-1,5-dione |
| SMILES | O=C1C=C(Br)c2cc(=O)cc(Br)cc21 |
| InChI | InChI=1S/C10H4Br2O2/c11-5-1-6(13)3-7-8(2-5)10(14)4-9(7)12/h1-4H |
| InChIKey | UCMOTAVPWAJINM-UHFFFAOYSA-N |
| XLogP | 2.74 |
| TPSA | 34.14 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | |
| Heavy Atoms | 14 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 315.95 |
| LogP ≤ 5 | 2.74 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
Analyze 3,7-dibromoazulene-1,5-dione with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 3,7-dibromoazulene-1,5-dione?
The IUPAC name of 3,7-dibromoazulene-1,5-dione (CID 11726819) is 3,7-dibromoazulene-1,5-dione.
What is the SMILES notation for 3,7-dibromoazulene-1,5-dione?
The canonical SMILES for 3,7-dibromoazulene-1,5-dione is O=C1C=C(Br)c2cc(=O)cc(Br)cc21.
What is the InChIKey of 3,7-dibromoazulene-1,5-dione?
The InChIKey is UCMOTAVPWAJINM-UHFFFAOYSA-N. The full InChI is InChI=1S/C10H4Br2O2/c11-5-1-6(13)3-7-8(2-5)10(14)4-9(7)12/h1-4H.
What are the key properties of 3,7-dibromoazulene-1,5-dione?
3,7-dibromoazulene-1,5-dione has a molecular weight of 315.95 g/mol, XLogP of 2.74, 0 rotatable bonds, 0 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for 3,7-dibromoazulene-1,5-dione is sourced from PubChem (CID 11726819), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).