About 3-(oxan-3-yl)but-3-enal
3-(oxan-3-yl)but-3-enal (PubChem CID 117268457) has the molecular formula C9H14O2
and a molecular weight of 154.21 g/mol. Its IUPAC name is 3-(oxan-3-yl)but-3-enal.
Molecular Properties
| Compound Name | 3-(oxan-3-yl)but-3-enal |
| PubChem CID | 117268457 |
| Molecular Formula | C9H14O2 |
| Molecular Weight | 154.21 g/mol |
| Exact Mass | 154.10 |
| IUPAC Name | 3-(oxan-3-yl)but-3-enal |
| SMILES | C=C(CC=O)C1CCCOC1 |
| InChI | InChI=1S/C9H14O2/c1-8(4-5-10)9-3-2-6-11-7-9/h5,9H,1-4,6-7H2 |
| InChIKey | VUSSBXKPBJECSL-UHFFFAOYSA-N |
| XLogP | 1.56 |
| TPSA | 26.30 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 11 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 154.21 |
| LogP ≤ 5 | 1.56 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|
Analyze 3-(oxan-3-yl)but-3-enal with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 3-(oxan-3-yl)but-3-enal?
The IUPAC name of 3-(oxan-3-yl)but-3-enal (CID 117268457) is 3-(oxan-3-yl)but-3-enal.
What is the SMILES notation for 3-(oxan-3-yl)but-3-enal?
The canonical SMILES for 3-(oxan-3-yl)but-3-enal is C=C(CC=O)C1CCCOC1.
What is the InChIKey of 3-(oxan-3-yl)but-3-enal?
The InChIKey is VUSSBXKPBJECSL-UHFFFAOYSA-N. The full InChI is InChI=1S/C9H14O2/c1-8(4-5-10)9-3-2-6-11-7-9/h5,9H,1-4,6-7H2.
What are the key properties of 3-(oxan-3-yl)but-3-enal?
3-(oxan-3-yl)but-3-enal has a molecular weight of 154.21 g/mol, XLogP of 1.56, 3 rotatable bonds, 0 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for 3-(oxan-3-yl)but-3-enal is sourced from PubChem (CID 117268457), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).