About methyl 4-[(1,1-dioxothiolan-2-yl)methyl]-2-methylpyrrolidine-2-carboxylate
methyl 4-[(1,1-dioxothiolan-2-yl)methyl]-2-methylpyrrolidine-2-carboxylate (PubChem CID 117270040) has the molecular formula C12H21NO4S
and a molecular weight of 275.37 g/mol. Its IUPAC name is methyl 4-[(1,1-dioxothiolan-2-yl)methyl]-2-methylpyrrolidine-2-carboxylate.
Molecular Properties
| Compound Name | methyl 4-[(1,1-dioxothiolan-2-yl)methyl]-2-methylpyrrolidine-2-carboxylate |
| PubChem CID | 117270040 |
| Molecular Formula | C12H21NO4S |
| Molecular Weight | 275.37 g/mol |
| Exact Mass | 275.12 |
| IUPAC Name | methyl 4-[(1,1-dioxothiolan-2-yl)methyl]-2-methylpyrrolidine-2-carboxylate |
| SMILES | COC(=O)C1(C)CC(CC2CCCS2(=O)=O)CN1 |
| InChI | InChI=1S/C12H21NO4S/c1-12(11(14)17-2)7-9(8-13-12)6-10-4-3-5-18(10,15)16/h9-10,13H,3-8H2,1-2H3 |
| InChIKey | QALNWWSMIOIZLY-UHFFFAOYSA-N |
| XLogP | 0.49 |
| TPSA | 72.47 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 18 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 275.37 |
| LogP ≤ 5 | 0.49 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
Analyze methyl 4-[(1,1-dioxothiolan-2-yl)methyl]-2-methylpyrrolidine-2-carboxylate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of methyl 4-[(1,1-dioxothiolan-2-yl)methyl]-2-methylpyrrolidine-2-carboxylate?
The IUPAC name of methyl 4-[(1,1-dioxothiolan-2-yl)methyl]-2-methylpyrrolidine-2-carboxylate (CID 117270040) is methyl 4-[(1,1-dioxothiolan-2-yl)methyl]-2-methylpyrrolidine-2-carboxylate.
What is the SMILES notation for methyl 4-[(1,1-dioxothiolan-2-yl)methyl]-2-methylpyrrolidine-2-carboxylate?
The canonical SMILES for methyl 4-[(1,1-dioxothiolan-2-yl)methyl]-2-methylpyrrolidine-2-carboxylate is COC(=O)C1(C)CC(CC2CCCS2(=O)=O)CN1.
What is the InChIKey of methyl 4-[(1,1-dioxothiolan-2-yl)methyl]-2-methylpyrrolidine-2-carboxylate?
The InChIKey is QALNWWSMIOIZLY-UHFFFAOYSA-N. The full InChI is InChI=1S/C12H21NO4S/c1-12(11(14)17-2)7-9(8-13-12)6-10-4-3-5-18(10,15)16/h9-10,13H,3-8H2,1-2H3.
What are the key properties of methyl 4-[(1,1-dioxothiolan-2-yl)methyl]-2-methylpyrrolidine-2-carboxylate?
methyl 4-[(1,1-dioxothiolan-2-yl)methyl]-2-methylpyrrolidine-2-carboxylate has a molecular weight of 275.37 g/mol, XLogP of 0.49, 3 rotatable bonds, 1 hydrogen bond donors, and 5 hydrogen bond acceptors.
Where does this data come from?
All data for methyl 4-[(1,1-dioxothiolan-2-yl)methyl]-2-methylpyrrolidine-2-carboxylate is sourced from PubChem (CID 117270040), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).