About [1-[methyl(prop-2-ynyl)amino]-2,3-dihydro-1H-inden-4-yl] N-ethyl-N-methylcarbamate
[1-[methyl(prop-2-ynyl)amino]-2,3-dihydro-1H-inden-4-yl] N-ethyl-N-methylcarbamate (PubChem CID 11727038) has the molecular formula C17H22N2O2
and a molecular weight of 286.38 g/mol. Its IUPAC name is [1-[methyl(prop-2-ynyl)amino]-2,3-dihydro-1H-inden-4-yl] N-ethyl-N-methylcarbamate.
Molecular Properties
| Compound Name | [1-[methyl(prop-2-ynyl)amino]-2,3-dihydro-1H-inden-4-yl] N-ethyl-N-methylcarbamate |
| PubChem CID | 11727038 |
| Molecular Formula | C17H22N2O2 |
| Molecular Weight | 286.38 g/mol |
| Exact Mass | 286.17 |
| IUPAC Name | [1-[methyl(prop-2-ynyl)amino]-2,3-dihydro-1H-inden-4-yl] N-ethyl-N-methylcarbamate |
| SMILES | C#CCN(C)C1CCc2c(OC(=O)N(C)CC)cccc21 |
| InChI | InChI=1S/C17H22N2O2/c1-5-12-19(4)15-11-10-14-13(15)8-7-9-16(14)21-17(20)18(3)6-2/h1,7-9,15H,6,10-12H2,2-4H3 |
| InChIKey | AGATWFCSQRRDGY-UHFFFAOYSA-N |
| XLogP | 2.69 |
| TPSA | 32.78 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 21 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 286.38 |
| LogP ≤ 5 | 2.69 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|
Analyze [1-[methyl(prop-2-ynyl)amino]-2,3-dihydro-1H-inden-4-yl] N-ethyl-N-methylcarbamate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of [1-[methyl(prop-2-ynyl)amino]-2,3-dihydro-1H-inden-4-yl] N-ethyl-N-methylcarbamate?
The IUPAC name of [1-[methyl(prop-2-ynyl)amino]-2,3-dihydro-1H-inden-4-yl] N-ethyl-N-methylcarbamate (CID 11727038) is [1-[methyl(prop-2-ynyl)amino]-2,3-dihydro-1H-inden-4-yl] N-ethyl-N-methylcarbamate.
What is the SMILES notation for [1-[methyl(prop-2-ynyl)amino]-2,3-dihydro-1H-inden-4-yl] N-ethyl-N-methylcarbamate?
The canonical SMILES for [1-[methyl(prop-2-ynyl)amino]-2,3-dihydro-1H-inden-4-yl] N-ethyl-N-methylcarbamate is C#CCN(C)C1CCc2c(OC(=O)N(C)CC)cccc21.
What is the InChIKey of [1-[methyl(prop-2-ynyl)amino]-2,3-dihydro-1H-inden-4-yl] N-ethyl-N-methylcarbamate?
The InChIKey is AGATWFCSQRRDGY-UHFFFAOYSA-N. The full InChI is InChI=1S/C17H22N2O2/c1-5-12-19(4)15-11-10-14-13(15)8-7-9-16(14)21-17(20)18(3)6-2/h1,7-9,15H,6,10-12H2,2-4H3.
What are the key properties of [1-[methyl(prop-2-ynyl)amino]-2,3-dihydro-1H-inden-4-yl] N-ethyl-N-methylcarbamate?
[1-[methyl(prop-2-ynyl)amino]-2,3-dihydro-1H-inden-4-yl] N-ethyl-N-methylcarbamate has a molecular weight of 286.38 g/mol, XLogP of 2.69, 4 rotatable bonds, 0 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for [1-[methyl(prop-2-ynyl)amino]-2,3-dihydro-1H-inden-4-yl] N-ethyl-N-methylcarbamate is sourced from PubChem (CID 11727038), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).