C20H31ClO — CID 11727039
(5Z,8Z,11Z,14Z)-icosa-5,8,11,14-tetraenoyl chloride (PubChem CID 11727039) has the molecular formula C20H31ClO and a molecular weight of 322.92 g/mol. Its IUPAC name is (5Z,8Z,11Z,14Z)-icosa-5,8,11,14-tetraenoyl chloride.
| Compound Name | (5Z,8Z,11Z,14Z)-icosa-5,8,11,14-tetraenoyl chloride |
|---|---|
| PubChem CID | 11727039 |
| Molecular Formula | C20H31ClO |
| Molecular Weight | 322.92 g/mol |
| Exact Mass | 322.21 |
| IUPAC Name | (5Z,8Z,11Z,14Z)-icosa-5,8,11,14-tetraenoyl chloride |
| SMILES | CCCCC/C=C\C/C=C\C/C=C\C/C=C\CCCC(=O)Cl |
| InChI | InChI=1S/C20H31ClO/c1-2-3-4-5-6-7-8-9-10-11-12-13-14-15-16-17-18-19-20(21)22/h6-7,9-10,12-13,15-16H,2-5,8,11,14,17-19H2,1H3/b7-6-,10-9-,13-12-,16-15- |
| InChIKey | NTBLHFFUSJRJQO-DOFZRALJSA-N |
| XLogP | 6.90 |
| TPSA | 17.07 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 14 |
| Heavy Atoms | 22 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 322.92 |
| LogP ≤ 5 | 6.90 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'acid_halide', 'substructure': 'N/A'}, {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|