About [4-[(1,1-dioxothian-4-yl)methyl]pyrrolidin-2-yl]methanol
[4-[(1,1-dioxothian-4-yl)methyl]pyrrolidin-2-yl]methanol (PubChem CID 117270425) has the molecular formula C11H21NO3S
and a molecular weight of 247.36 g/mol. Its IUPAC name is [4-[(1,1-dioxothian-4-yl)methyl]pyrrolidin-2-yl]methanol.
Molecular Properties
| Compound Name | [4-[(1,1-dioxothian-4-yl)methyl]pyrrolidin-2-yl]methanol |
| PubChem CID | 117270425 |
| Molecular Formula | C11H21NO3S |
| Molecular Weight | 247.36 g/mol |
| Exact Mass | 247.12 |
| IUPAC Name | [4-[(1,1-dioxothian-4-yl)methyl]pyrrolidin-2-yl]methanol |
| SMILES | O=S1(=O)CCC(CC2CNC(CO)C2)CC1 |
| InChI | InChI=1S/C11H21NO3S/c13-8-11-6-10(7-12-11)5-9-1-3-16(14,15)4-2-9/h9-13H,1-8H2 |
| InChIKey | BSIBICACEXZFRY-UHFFFAOYSA-N |
| XLogP | 0.17 |
| TPSA | 66.40 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 16 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 247.36 |
| LogP ≤ 5 | 0.17 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
Analyze [4-[(1,1-dioxothian-4-yl)methyl]pyrrolidin-2-yl]methanol with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of [4-[(1,1-dioxothian-4-yl)methyl]pyrrolidin-2-yl]methanol?
The IUPAC name of [4-[(1,1-dioxothian-4-yl)methyl]pyrrolidin-2-yl]methanol (CID 117270425) is [4-[(1,1-dioxothian-4-yl)methyl]pyrrolidin-2-yl]methanol.
What is the SMILES notation for [4-[(1,1-dioxothian-4-yl)methyl]pyrrolidin-2-yl]methanol?
The canonical SMILES for [4-[(1,1-dioxothian-4-yl)methyl]pyrrolidin-2-yl]methanol is O=S1(=O)CCC(CC2CNC(CO)C2)CC1.
What is the InChIKey of [4-[(1,1-dioxothian-4-yl)methyl]pyrrolidin-2-yl]methanol?
The InChIKey is BSIBICACEXZFRY-UHFFFAOYSA-N. The full InChI is InChI=1S/C11H21NO3S/c13-8-11-6-10(7-12-11)5-9-1-3-16(14,15)4-2-9/h9-13H,1-8H2.
What are the key properties of [4-[(1,1-dioxothian-4-yl)methyl]pyrrolidin-2-yl]methanol?
[4-[(1,1-dioxothian-4-yl)methyl]pyrrolidin-2-yl]methanol has a molecular weight of 247.36 g/mol, XLogP of 0.17, 3 rotatable bonds, 2 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for [4-[(1,1-dioxothian-4-yl)methyl]pyrrolidin-2-yl]methanol is sourced from PubChem (CID 117270425), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).