C16H18F6 — CID 11727067
(5Z)-3-tert-butyl-5-(1,2,2,3,3,3-hexafluoropropylidene)-2-methyl-1-prop-1-en-2-ylcyclopenta-1,3-diene (PubChem CID 11727067) has the molecular formula C16H18F6 and a molecular weight of 324.31 g/mol. Its IUPAC name is (5Z)-3-tert-butyl-5-(1,2,2,3,3,3-hexafluoropropylidene)-2-methyl-1-prop-1-en-2-ylcyclopenta-1,3-diene.
| Compound Name | (5Z)-3-tert-butyl-5-(1,2,2,3,3,3-hexafluoropropylidene)-2-methyl-1-prop-1-en-2-ylcyclopenta-1,3-diene |
|---|---|
| PubChem CID | 11727067 |
| Molecular Formula | C16H18F6 |
| Molecular Weight | 324.31 g/mol |
| Exact Mass | 324.13 |
| IUPAC Name | (5Z)-3-tert-butyl-5-(1,2,2,3,3,3-hexafluoropropylidene)-2-methyl-1-prop-1-en-2-ylcyclopenta-1,3-diene |
| SMILES | C=C(C)C1=C(C)C(C(C)(C)C)=C/C1=C(/F)C(F)(F)C(F)(F)F |
| InChI | InChI=1S/C16H18F6/c1-8(2)12-9(3)11(14(4,5)6)7-10(12)13(17)15(18,19)16(20,21)22/h7H,1H2,2-6H3/b13-10- |
| InChIKey | SDTSLQUJCMEXLD-RAXLEYEMSA-N |
| XLogP | 6.29 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | 2 |
| Heavy Atoms | 22 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 324.31 |
| LogP ≤ 5 | 6.29 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |
| Structural Alerts | {'alert_name': 'Perfluorinated_chain', 'substructure': 'N/A'} |
|---|