C19H38O2Si — CID 11727148
cis-(2R,5S)-5-propan-2-yl-2-[tri(propan-2-yl)silyloxymethyl]cyclohexan-1-one (PubChem CID 11727148) has the molecular formula C19H38O2Si and a molecular weight of 326.60 g/mol. Its IUPAC name is cis-(2R,5S)-5-propan-2-yl-2-[tri(propan-2-yl)silyloxymethyl]cyclohexan-1-one.
| Compound Name | cis-(2R,5S)-5-propan-2-yl-2-[tri(propan-2-yl)silyloxymethyl]cyclohexan-1-one |
|---|---|
| PubChem CID | 11727148 |
| Molecular Formula | C19H38O2Si |
| Molecular Weight | 326.60 g/mol |
| Exact Mass | 326.26 |
| IUPAC Name | cis-(2R,5S)-5-propan-2-yl-2-[tri(propan-2-yl)silyloxymethyl]cyclohexan-1-one |
| SMILES | CC(C)[C@H]1CC[C@H](CO[Si](C(C)C)(C(C)C)C(C)C)C(=O)C1 |
| InChI | InChI=1S/C19H38O2Si/c1-13(2)17-9-10-18(19(20)11-17)12-21-22(14(3)4,15(5)6)16(7)8/h13-18H,9-12H2,1-8H3/t17-,18+/m0/s1 |
| InChIKey | CXGRJAKMBDDRIO-ZWKOTPCHSA-N |
| XLogP | 5.82 |
| TPSA | 26.30 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 22 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 326.60 |
| LogP ≤ 5 | 5.82 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|