About 5-(4-fluorophenyl)-2,2-dimethylpyrrolidine
5-(4-fluorophenyl)-2,2-dimethylpyrrolidine (PubChem CID 117272276) has the molecular formula C12H16FN
and a molecular weight of 193.27 g/mol. Its IUPAC name is 5-(4-fluorophenyl)-2,2-dimethylpyrrolidine.
Molecular Properties
| Compound Name | 5-(4-fluorophenyl)-2,2-dimethylpyrrolidine |
| PubChem CID | 117272276 |
| Molecular Formula | C12H16FN |
| Molecular Weight | 193.27 g/mol |
| Exact Mass | 193.13 |
| IUPAC Name | 5-(4-fluorophenyl)-2,2-dimethylpyrrolidine |
| SMILES | CC1(C)CCC(c2ccc(F)cc2)N1 |
| InChI | InChI=1S/C12H16FN/c1-12(2)8-7-11(14-12)9-3-5-10(13)6-4-9/h3-6,11,14H,7-8H2,1-2H3 |
| InChIKey | VFCNABBVOVXRFW-UHFFFAOYSA-N |
| XLogP | 3.03 |
| TPSA | 12.03 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 14 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 193.27 |
| LogP ≤ 5 | 3.03 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |
Analyze 5-(4-fluorophenyl)-2,2-dimethylpyrrolidine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 5-(4-fluorophenyl)-2,2-dimethylpyrrolidine?
The IUPAC name of 5-(4-fluorophenyl)-2,2-dimethylpyrrolidine (CID 117272276) is 5-(4-fluorophenyl)-2,2-dimethylpyrrolidine.
What is the SMILES notation for 5-(4-fluorophenyl)-2,2-dimethylpyrrolidine?
The canonical SMILES for 5-(4-fluorophenyl)-2,2-dimethylpyrrolidine is CC1(C)CCC(c2ccc(F)cc2)N1.
What is the InChIKey of 5-(4-fluorophenyl)-2,2-dimethylpyrrolidine?
The InChIKey is VFCNABBVOVXRFW-UHFFFAOYSA-N. The full InChI is InChI=1S/C12H16FN/c1-12(2)8-7-11(14-12)9-3-5-10(13)6-4-9/h3-6,11,14H,7-8H2,1-2H3.
What are the key properties of 5-(4-fluorophenyl)-2,2-dimethylpyrrolidine?
5-(4-fluorophenyl)-2,2-dimethylpyrrolidine has a molecular weight of 193.27 g/mol, XLogP of 3.03, 1 rotatable bonds, 1 hydrogen bond donors, and 1 hydrogen bond acceptors.
Where does this data come from?
All data for 5-(4-fluorophenyl)-2,2-dimethylpyrrolidine is sourced from PubChem (CID 117272276), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).