About 5-(4-methoxyphenyl)-2,2-dimethylpyrrolidine
5-(4-methoxyphenyl)-2,2-dimethylpyrrolidine (PubChem CID 117272286) has the molecular formula C13H19NO
and a molecular weight of 205.30 g/mol. Its IUPAC name is 5-(4-methoxyphenyl)-2,2-dimethylpyrrolidine.
Molecular Properties
| Compound Name | 5-(4-methoxyphenyl)-2,2-dimethylpyrrolidine |
| PubChem CID | 117272286 |
| Molecular Formula | C13H19NO |
| Molecular Weight | 205.30 g/mol |
| Exact Mass | 205.15 |
| IUPAC Name | 5-(4-methoxyphenyl)-2,2-dimethylpyrrolidine |
| SMILES | COc1ccc(C2CCC(C)(C)N2)cc1 |
| InChI | InChI=1S/C13H19NO/c1-13(2)9-8-12(14-13)10-4-6-11(15-3)7-5-10/h4-7,12,14H,8-9H2,1-3H3 |
| InChIKey | YFBRKVJOHPAEJR-UHFFFAOYSA-N |
| XLogP | 2.90 |
| TPSA | 21.26 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 15 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 205.30 |
| LogP ≤ 5 | 2.90 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
Analyze 5-(4-methoxyphenyl)-2,2-dimethylpyrrolidine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 5-(4-methoxyphenyl)-2,2-dimethylpyrrolidine?
The IUPAC name of 5-(4-methoxyphenyl)-2,2-dimethylpyrrolidine (CID 117272286) is 5-(4-methoxyphenyl)-2,2-dimethylpyrrolidine.
What is the SMILES notation for 5-(4-methoxyphenyl)-2,2-dimethylpyrrolidine?
The canonical SMILES for 5-(4-methoxyphenyl)-2,2-dimethylpyrrolidine is COc1ccc(C2CCC(C)(C)N2)cc1.
What is the InChIKey of 5-(4-methoxyphenyl)-2,2-dimethylpyrrolidine?
The InChIKey is YFBRKVJOHPAEJR-UHFFFAOYSA-N. The full InChI is InChI=1S/C13H19NO/c1-13(2)9-8-12(14-13)10-4-6-11(15-3)7-5-10/h4-7,12,14H,8-9H2,1-3H3.
What are the key properties of 5-(4-methoxyphenyl)-2,2-dimethylpyrrolidine?
5-(4-methoxyphenyl)-2,2-dimethylpyrrolidine has a molecular weight of 205.30 g/mol, XLogP of 2.90, 2 rotatable bonds, 1 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for 5-(4-methoxyphenyl)-2,2-dimethylpyrrolidine is sourced from PubChem (CID 117272286), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).