About 8-(hydroxymethyl)-2,5,6,7-tetrahydro-1H-pyrrolizin-3-one
8-(hydroxymethyl)-2,5,6,7-tetrahydro-1H-pyrrolizin-3-one (PubChem CID 117272750) has the molecular formula C8H13NO2
and a molecular weight of 155.20 g/mol. Its IUPAC name is 8-(hydroxymethyl)-2,5,6,7-tetrahydro-1H-pyrrolizin-3-one.
Molecular Properties
| Compound Name | 8-(hydroxymethyl)-2,5,6,7-tetrahydro-1H-pyrrolizin-3-one |
| PubChem CID | 117272750 |
| Molecular Formula | C8H13NO2 |
| Molecular Weight | 155.20 g/mol |
| Exact Mass | 155.09 |
| IUPAC Name | 8-(hydroxymethyl)-2,5,6,7-tetrahydro-1H-pyrrolizin-3-one |
| SMILES | O=C1CCC2(CO)CCCN12 |
| InChI | InChI=1S/C8H13NO2/c10-6-8-3-1-5-9(8)7(11)2-4-8/h10H,1-6H2 |
| InChIKey | BVABYDGUFSXLTG-UHFFFAOYSA-N |
| XLogP | 0.13 |
| TPSA | 40.54 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 11 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 155.20 |
| LogP ≤ 5 | 0.13 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
Analyze 8-(hydroxymethyl)-2,5,6,7-tetrahydro-1H-pyrrolizin-3-one with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 8-(hydroxymethyl)-2,5,6,7-tetrahydro-1H-pyrrolizin-3-one?
The IUPAC name of 8-(hydroxymethyl)-2,5,6,7-tetrahydro-1H-pyrrolizin-3-one (CID 117272750) is 8-(hydroxymethyl)-2,5,6,7-tetrahydro-1H-pyrrolizin-3-one.
What is the SMILES notation for 8-(hydroxymethyl)-2,5,6,7-tetrahydro-1H-pyrrolizin-3-one?
The canonical SMILES for 8-(hydroxymethyl)-2,5,6,7-tetrahydro-1H-pyrrolizin-3-one is O=C1CCC2(CO)CCCN12.
What is the InChIKey of 8-(hydroxymethyl)-2,5,6,7-tetrahydro-1H-pyrrolizin-3-one?
The InChIKey is BVABYDGUFSXLTG-UHFFFAOYSA-N. The full InChI is InChI=1S/C8H13NO2/c10-6-8-3-1-5-9(8)7(11)2-4-8/h10H,1-6H2.
What are the key properties of 8-(hydroxymethyl)-2,5,6,7-tetrahydro-1H-pyrrolizin-3-one?
8-(hydroxymethyl)-2,5,6,7-tetrahydro-1H-pyrrolizin-3-one has a molecular weight of 155.20 g/mol, XLogP of 0.13, 1 rotatable bonds, 1 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for 8-(hydroxymethyl)-2,5,6,7-tetrahydro-1H-pyrrolizin-3-one is sourced from PubChem (CID 117272750), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).