About 3-chloro-5,7-dimethylimidazo[4,5-c]pyridazin-6-one
3-chloro-5,7-dimethylimidazo[4,5-c]pyridazin-6-one (PubChem CID 117272908) has the molecular formula C7H7ClN4O
and a molecular weight of 198.61 g/mol. Its IUPAC name is 3-chloro-5,7-dimethylimidazo[4,5-c]pyridazin-6-one.
Molecular Properties
| Compound Name | 3-chloro-5,7-dimethylimidazo[4,5-c]pyridazin-6-one |
| PubChem CID | 117272908 |
| Molecular Formula | C7H7ClN4O |
| Molecular Weight | 198.61 g/mol |
| Exact Mass | 198.03 |
| IUPAC Name | 3-chloro-5,7-dimethylimidazo[4,5-c]pyridazin-6-one |
| SMILES | Cn1c(=O)n(C)c2nnc(Cl)cc21 |
| InChI | InChI=1S/C7H7ClN4O/c1-11-4-3-5(8)9-10-6(4)12(2)7(11)13/h3H,1-2H3 |
| InChIKey | NAIIDYZJNLLEFH-UHFFFAOYSA-N |
| XLogP | 0.32 |
| TPSA | 52.71 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | |
| Heavy Atoms | 13 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 198.61 |
| LogP ≤ 5 | 0.32 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
Analyze 3-chloro-5,7-dimethylimidazo[4,5-c]pyridazin-6-one with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 3-chloro-5,7-dimethylimidazo[4,5-c]pyridazin-6-one?
The IUPAC name of 3-chloro-5,7-dimethylimidazo[4,5-c]pyridazin-6-one (CID 117272908) is 3-chloro-5,7-dimethylimidazo[4,5-c]pyridazin-6-one.
What is the SMILES notation for 3-chloro-5,7-dimethylimidazo[4,5-c]pyridazin-6-one?
The canonical SMILES for 3-chloro-5,7-dimethylimidazo[4,5-c]pyridazin-6-one is Cn1c(=O)n(C)c2nnc(Cl)cc21.
What is the InChIKey of 3-chloro-5,7-dimethylimidazo[4,5-c]pyridazin-6-one?
The InChIKey is NAIIDYZJNLLEFH-UHFFFAOYSA-N. The full InChI is InChI=1S/C7H7ClN4O/c1-11-4-3-5(8)9-10-6(4)12(2)7(11)13/h3H,1-2H3.
What are the key properties of 3-chloro-5,7-dimethylimidazo[4,5-c]pyridazin-6-one?
3-chloro-5,7-dimethylimidazo[4,5-c]pyridazin-6-one has a molecular weight of 198.61 g/mol, XLogP of 0.32, 0 rotatable bonds, 0 hydrogen bond donors, and 5 hydrogen bond acceptors.
Where does this data come from?
All data for 3-chloro-5,7-dimethylimidazo[4,5-c]pyridazin-6-one is sourced from PubChem (CID 117272908), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).