C7H8N4S — CID 117273013
7-methylsulfanylpyrazolo[1,5-c]pyrimidin-5-amine (PubChem CID 117273013) has the molecular formula C7H8N4S and a molecular weight of 180.24 g/mol. Its IUPAC name is 7-methylsulfanylpyrazolo[1,5-c]pyrimidin-5-amine.
| Compound Name | 7-methylsulfanylpyrazolo[1,5-c]pyrimidin-5-amine |
|---|---|
| PubChem CID | 117273013 |
| Molecular Formula | C7H8N4S |
| Molecular Weight | 180.24 g/mol |
| Exact Mass | 180.05 |
| IUPAC Name | 7-methylsulfanylpyrazolo[1,5-c]pyrimidin-5-amine |
| SMILES | CSc1nc(N)cc2ccnn12 |
| InChI | InChI=1S/C7H8N4S/c1-12-7-10-6(8)4-5-2-3-9-11(5)7/h2-4H,8H2,1H3 |
| InChIKey | OWJAKSQPYBPNIP-UHFFFAOYSA-N |
| XLogP | 1.03 |
| TPSA | 56.21 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 12 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 180.24 |
| LogP ≤ 5 | 1.03 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |