C20H28O4 — CID 11727307
(1S,4S,6S,10R,14E)-14-[2-(3,3-dimethyloxiran-2-yl)ethylidene]-4-methyl-9-methylidene-5,12-dioxatricyclo[8.4.0.04,6]tetradecan-11-one (PubChem CID 11727307) has the molecular formula C20H28O4 and a molecular weight of 332.44 g/mol. Its IUPAC name is (1S,4S,6S,10R,14E)-14-[2-(3,3-dimethyloxiran-2-yl)ethylidene]-4-methyl-9-methylidene-5,12-dioxatricyclo[8.4.0.04,6]tetradecan-11-one.
| Compound Name | (1S,4S,6S,10R,14E)-14-[2-(3,3-dimethyloxiran-2-yl)ethylidene]-4-methyl-9-methylidene-5,12-dioxatricyclo[8.4.0.04,6]tetradecan-11-one |
|---|---|
| PubChem CID | 11727307 |
| Molecular Formula | C20H28O4 |
| Molecular Weight | 332.44 g/mol |
| Exact Mass | 332.20 |
| IUPAC Name | (1S,4S,6S,10R,14E)-14-[2-(3,3-dimethyloxiran-2-yl)ethylidene]-4-methyl-9-methylidene-5,12-dioxatricyclo[8.4.0.04,6]tetradecan-11-one |
| SMILES | C=C1CC[C@@H]2O[C@@]2(C)CC[C@@H]2/C(=C\CC3OC3(C)C)COC(=O)[C@@H]12 |
| InChI | InChI=1S/C20H28O4/c1-12-5-7-16-20(4,24-16)10-9-14-13(11-22-18(21)17(12)14)6-8-15-19(2,3)23-15/h6,14-17H,1,5,7-11H2,2-4H3/b13-6-/t14-,15?,16+,17+,20+/m1/s1 |
| InChIKey | HBFMHROJNZWLBE-SCWJKOTBSA-N |
| XLogP | 3.56 |
| TPSA | 51.36 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 332.44 |
| LogP ≤ 5 | 3.56 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'Three-membered_heterocycle', 'substructure': 'N/A'} |
|---|