About 6-amino-2,3,6,7,8,8a-hexahydro-1H-indolizin-5-one
6-amino-2,3,6,7,8,8a-hexahydro-1H-indolizin-5-one (PubChem CID 117273495) has the molecular formula C8H14N2O
and a molecular weight of 154.21 g/mol. Its IUPAC name is 6-amino-2,3,6,7,8,8a-hexahydro-1H-indolizin-5-one.
Analyze 6-amino-2,3,6,7,8,8a-hexahydro-1H-indolizin-5-one with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 6-amino-2,3,6,7,8,8a-hexahydro-1H-indolizin-5-one?
The IUPAC name of 6-amino-2,3,6,7,8,8a-hexahydro-1H-indolizin-5-one (CID 117273495) is 6-amino-2,3,6,7,8,8a-hexahydro-1H-indolizin-5-one.
What is the SMILES notation for 6-amino-2,3,6,7,8,8a-hexahydro-1H-indolizin-5-one?
The canonical SMILES for 6-amino-2,3,6,7,8,8a-hexahydro-1H-indolizin-5-one is NC1CCC2CCCN2C1=O.
What is the InChIKey of 6-amino-2,3,6,7,8,8a-hexahydro-1H-indolizin-5-one?
The InChIKey is YIBMSNBNHHHNTP-UHFFFAOYSA-N. The full InChI is InChI=1S/C8H14N2O/c9-7-4-3-6-2-1-5-10(6)8(7)11/h6-7H,1-5,9H2.
What are the key properties of 6-amino-2,3,6,7,8,8a-hexahydro-1H-indolizin-5-one?
6-amino-2,3,6,7,8,8a-hexahydro-1H-indolizin-5-one has a molecular weight of 154.21 g/mol, XLogP of 0.10, 0 rotatable bonds, 1 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for 6-amino-2,3,6,7,8,8a-hexahydro-1H-indolizin-5-one is sourced from PubChem (CID 117273495), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).