C14H18BrN — CID 117274099
8a-(2-bromophenyl)-2,3,5,6,7,8-hexahydro-1H-indolizine (PubChem CID 117274099) has the molecular formula C14H18BrN and a molecular weight of 280.21 g/mol. Its IUPAC name is 8a-(2-bromophenyl)-2,3,5,6,7,8-hexahydro-1H-indolizine.
| Compound Name | 8a-(2-bromophenyl)-2,3,5,6,7,8-hexahydro-1H-indolizine |
|---|---|
| PubChem CID | 117274099 |
| Molecular Formula | C14H18BrN |
| Molecular Weight | 280.21 g/mol |
| Exact Mass | 279.06 |
| IUPAC Name | 8a-(2-bromophenyl)-2,3,5,6,7,8-hexahydro-1H-indolizine |
| SMILES | Brc1ccccc1C12CCCCN1CCC2 |
| InChI | InChI=1S/C14H18BrN/c15-13-7-2-1-6-12(13)14-8-3-4-10-16(14)11-5-9-14/h1-2,6-7H,3-5,8-11H2 |
| InChIKey | PFVYTJCNTXWDJD-UHFFFAOYSA-N |
| XLogP | 3.92 |
| TPSA | 3.24 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 280.21 |
| LogP ≤ 5 | 3.92 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |