About 5-bromospiro[1,3-benzodioxole-2,4'-cyclohexane]-1'-one
5-bromospiro[1,3-benzodioxole-2,4'-cyclohexane]-1'-one (PubChem CID 117274122) has the molecular formula C12H11BrO3
and a molecular weight of 283.12 g/mol. Its IUPAC name is 5-bromospiro[1,3-benzodioxole-2,4'-cyclohexane]-1'-one.
Molecular Properties
| Compound Name | 5-bromospiro[1,3-benzodioxole-2,4'-cyclohexane]-1'-one |
| PubChem CID | 117274122 |
| Molecular Formula | C12H11BrO3 |
| Molecular Weight | 283.12 g/mol |
| Exact Mass | 281.99 |
| IUPAC Name | 5-bromospiro[1,3-benzodioxole-2,4'-cyclohexane]-1'-one |
| SMILES | O=C1CCC2(CC1)Oc1ccc(Br)cc1O2 |
| InChI | InChI=1S/C12H11BrO3/c13-8-1-2-10-11(7-8)16-12(15-10)5-3-9(14)4-6-12/h1-2,7H,3-6H2 |
| InChIKey | VHXINXLJXOAVGV-UHFFFAOYSA-N |
| XLogP | 3.06 |
| TPSA | 35.53 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | |
| Heavy Atoms | 16 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 283.12 |
| LogP ≤ 5 | 3.06 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
Analyze 5-bromospiro[1,3-benzodioxole-2,4'-cyclohexane]-1'-one with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 5-bromospiro[1,3-benzodioxole-2,4'-cyclohexane]-1'-one?
The IUPAC name of 5-bromospiro[1,3-benzodioxole-2,4'-cyclohexane]-1'-one (CID 117274122) is 5-bromospiro[1,3-benzodioxole-2,4'-cyclohexane]-1'-one.
What is the SMILES notation for 5-bromospiro[1,3-benzodioxole-2,4'-cyclohexane]-1'-one?
The canonical SMILES for 5-bromospiro[1,3-benzodioxole-2,4'-cyclohexane]-1'-one is O=C1CCC2(CC1)Oc1ccc(Br)cc1O2.
What is the InChIKey of 5-bromospiro[1,3-benzodioxole-2,4'-cyclohexane]-1'-one?
The InChIKey is VHXINXLJXOAVGV-UHFFFAOYSA-N. The full InChI is InChI=1S/C12H11BrO3/c13-8-1-2-10-11(7-8)16-12(15-10)5-3-9(14)4-6-12/h1-2,7H,3-6H2.
What are the key properties of 5-bromospiro[1,3-benzodioxole-2,4'-cyclohexane]-1'-one?
5-bromospiro[1,3-benzodioxole-2,4'-cyclohexane]-1'-one has a molecular weight of 283.12 g/mol, XLogP of 3.06, 0 rotatable bonds, 0 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for 5-bromospiro[1,3-benzodioxole-2,4'-cyclohexane]-1'-one is sourced from PubChem (CID 117274122), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).