C20H32O4 — CID 11727440
(2S,4Z)-2-[(1R,2R)-2-[(E,1R,4R)-1,4-dihydroxynon-2-enyl]cyclopropyl]-3,6,7,8-tetrahydro-2H-oxonin-9-one (PubChem CID 11727440) has the molecular formula C20H32O4 and a molecular weight of 336.47 g/mol. Its IUPAC name is (2S,4Z)-2-[(1R,2R)-2-[(E,1R,4R)-1,4-dihydroxynon-2-enyl]cyclopropyl]-3,6,7,8-tetrahydro-2H-oxonin-9-one.
| Compound Name | (2S,4Z)-2-[(1R,2R)-2-[(E,1R,4R)-1,4-dihydroxynon-2-enyl]cyclopropyl]-3,6,7,8-tetrahydro-2H-oxonin-9-one |
|---|---|
| PubChem CID | 11727440 |
| Molecular Formula | C20H32O4 |
| Molecular Weight | 336.47 g/mol |
| Exact Mass | 336.23 |
| IUPAC Name | (2S,4Z)-2-[(1R,2R)-2-[(E,1R,4R)-1,4-dihydroxynon-2-enyl]cyclopropyl]-3,6,7,8-tetrahydro-2H-oxonin-9-one |
| SMILES | CCCCC[C@@H](O)/C=C/[C@@H](O)[C@@H]1C[C@H]1[C@@H]1C/C=C\CCCC(=O)O1 |
| InChI | InChI=1S/C20H32O4/c1-2-3-6-9-15(21)12-13-18(22)16-14-17(16)19-10-7-4-5-8-11-20(23)24-19/h4,7,12-13,15-19,21-22H,2-3,5-6,8-11,14H2,1H3/b7-4-,13-12+/t15-,16-,17-,18-,19+/m1/s1 |
| InChIKey | BUWOMMLMRPPTEZ-LFQRMHLBSA-N |
| XLogP | 3.52 |
| TPSA | 66.76 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 336.47 |
| LogP ≤ 5 | 3.52 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|