C9H8F2N2 — CID 117274554
5,7-difluoro-1-methylindol-6-amine (PubChem CID 117274554) has the molecular formula C9H8F2N2 and a molecular weight of 182.17 g/mol. Its IUPAC name is 5,7-difluoro-1-methylindol-6-amine.
| Compound Name | 5,7-difluoro-1-methylindol-6-amine |
|---|---|
| PubChem CID | 117274554 |
| Molecular Formula | C9H8F2N2 |
| Molecular Weight | 182.17 g/mol |
| Exact Mass | 182.07 |
| IUPAC Name | 5,7-difluoro-1-methylindol-6-amine |
| SMILES | Cn1ccc2cc(F)c(N)c(F)c21 |
| InChI | InChI=1S/C9H8F2N2/c1-13-3-2-5-4-6(10)8(12)7(11)9(5)13/h2-4H,12H2,1H3 |
| InChIKey | SGCUFMNIFVXFSY-UHFFFAOYSA-N |
| XLogP | 2.04 |
| TPSA | 30.95 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | |
| Heavy Atoms | 13 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 182.17 |
| LogP ≤ 5 | 2.04 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'} |
|---|