About 6-(2-hydroxyethyl)-1,3-oxazinane-2-thione
6-(2-hydroxyethyl)-1,3-oxazinane-2-thione (PubChem CID 117274597) has the molecular formula C6H11NO2S
and a molecular weight of 161.23 g/mol. Its IUPAC name is 6-(2-hydroxyethyl)-1,3-oxazinane-2-thione.
Molecular Properties
| Compound Name | 6-(2-hydroxyethyl)-1,3-oxazinane-2-thione |
| PubChem CID | 117274597 |
| Molecular Formula | C6H11NO2S |
| Molecular Weight | 161.23 g/mol |
| Exact Mass | 161.05 |
| IUPAC Name | 6-(2-hydroxyethyl)-1,3-oxazinane-2-thione |
| SMILES | OCCC1CCNC(=S)O1 |
| InChI | InChI=1S/C6H11NO2S/c8-4-2-5-1-3-7-6(10)9-5/h5,8H,1-4H2,(H,7,10) |
| InChIKey | BGAZZMUYOZEZGP-UHFFFAOYSA-N |
| XLogP | 0.03 |
| TPSA | 41.49 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 10 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 161.23 |
| LogP ≤ 5 | 0.03 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|
Analyze 6-(2-hydroxyethyl)-1,3-oxazinane-2-thione with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 6-(2-hydroxyethyl)-1,3-oxazinane-2-thione?
The IUPAC name of 6-(2-hydroxyethyl)-1,3-oxazinane-2-thione (CID 117274597) is 6-(2-hydroxyethyl)-1,3-oxazinane-2-thione.
What is the SMILES notation for 6-(2-hydroxyethyl)-1,3-oxazinane-2-thione?
The canonical SMILES for 6-(2-hydroxyethyl)-1,3-oxazinane-2-thione is OCCC1CCNC(=S)O1.
What is the InChIKey of 6-(2-hydroxyethyl)-1,3-oxazinane-2-thione?
The InChIKey is BGAZZMUYOZEZGP-UHFFFAOYSA-N. The full InChI is InChI=1S/C6H11NO2S/c8-4-2-5-1-3-7-6(10)9-5/h5,8H,1-4H2,(H,7,10).
What are the key properties of 6-(2-hydroxyethyl)-1,3-oxazinane-2-thione?
6-(2-hydroxyethyl)-1,3-oxazinane-2-thione has a molecular weight of 161.23 g/mol, XLogP of 0.03, 2 rotatable bonds, 2 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for 6-(2-hydroxyethyl)-1,3-oxazinane-2-thione is sourced from PubChem (CID 117274597), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).