C10H18N2O3 — CID 117274614
6-(hydroxymethyl)-3-piperidin-4-yl-1,3-oxazinan-2-one (PubChem CID 117274614) has the molecular formula C10H18N2O3 and a molecular weight of 214.26 g/mol. Its IUPAC name is 6-(hydroxymethyl)-3-piperidin-4-yl-1,3-oxazinan-2-one.
| Compound Name | 6-(hydroxymethyl)-3-piperidin-4-yl-1,3-oxazinan-2-one |
|---|---|
| PubChem CID | 117274614 |
| Molecular Formula | C10H18N2O3 |
| Molecular Weight | 214.26 g/mol |
| Exact Mass | 214.13 |
| IUPAC Name | 6-(hydroxymethyl)-3-piperidin-4-yl-1,3-oxazinan-2-one |
| SMILES | O=C1OC(CO)CCN1C1CCNCC1 |
| InChI | InChI=1S/C10H18N2O3/c13-7-9-3-6-12(10(14)15-9)8-1-4-11-5-2-8/h8-9,11,13H,1-7H2 |
| InChIKey | JUHDVFQCIDYBCN-UHFFFAOYSA-N |
| XLogP | -0.06 |
| TPSA | 61.80 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 214.26 |
| LogP ≤ 5 | -0.06 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |