About 3-fluoro-4,5-bis(methylsulfonyl)benzaldehyde
3-fluoro-4,5-bis(methylsulfonyl)benzaldehyde (PubChem CID 117275448) has the molecular formula C9H9FO5S2
and a molecular weight of 280.30 g/mol. Its IUPAC name is 3-fluoro-4,5-bis(methylsulfonyl)benzaldehyde.
Molecular Properties
| Compound Name | 3-fluoro-4,5-bis(methylsulfonyl)benzaldehyde |
| PubChem CID | 117275448 |
| Molecular Formula | C9H9FO5S2 |
| Molecular Weight | 280.30 g/mol |
| Exact Mass | 279.99 |
| IUPAC Name | 3-fluoro-4,5-bis(methylsulfonyl)benzaldehyde |
| SMILES | CS(=O)(=O)c1cc(C=O)cc(F)c1S(C)(=O)=O |
| InChI | InChI=1S/C9H9FO5S2/c1-16(12,13)8-4-6(5-11)3-7(10)9(8)17(2,14)15/h3-5H,1-2H3 |
| InChIKey | COFUTQGYXMNJNX-UHFFFAOYSA-N |
| XLogP | 0.45 |
| TPSA | 85.35 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 17 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 280.30 |
| LogP ≤ 5 | 0.45 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'} |
|---|
Analyze 3-fluoro-4,5-bis(methylsulfonyl)benzaldehyde with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 3-fluoro-4,5-bis(methylsulfonyl)benzaldehyde?
The IUPAC name of 3-fluoro-4,5-bis(methylsulfonyl)benzaldehyde (CID 117275448) is 3-fluoro-4,5-bis(methylsulfonyl)benzaldehyde.
What is the SMILES notation for 3-fluoro-4,5-bis(methylsulfonyl)benzaldehyde?
The canonical SMILES for 3-fluoro-4,5-bis(methylsulfonyl)benzaldehyde is CS(=O)(=O)c1cc(C=O)cc(F)c1S(C)(=O)=O.
What is the InChIKey of 3-fluoro-4,5-bis(methylsulfonyl)benzaldehyde?
The InChIKey is COFUTQGYXMNJNX-UHFFFAOYSA-N. The full InChI is InChI=1S/C9H9FO5S2/c1-16(12,13)8-4-6(5-11)3-7(10)9(8)17(2,14)15/h3-5H,1-2H3.
What are the key properties of 3-fluoro-4,5-bis(methylsulfonyl)benzaldehyde?
3-fluoro-4,5-bis(methylsulfonyl)benzaldehyde has a molecular weight of 280.30 g/mol, XLogP of 0.45, 3 rotatable bonds, 0 hydrogen bond donors, and 5 hydrogen bond acceptors.
Where does this data come from?
All data for 3-fluoro-4,5-bis(methylsulfonyl)benzaldehyde is sourced from PubChem (CID 117275448), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).