C9H9FO5S2 — CID 117275448
3-fluoro-4,5-bis(methylsulfonyl)benzaldehyde (PubChem CID 117275448) has the molecular formula C9H9FO5S2 and a molecular weight of 280.30 g/mol. Its IUPAC name is 3-fluoro-4,5-bis(methylsulfonyl)benzaldehyde.
| Compound Name | 3-fluoro-4,5-bis(methylsulfonyl)benzaldehyde |
|---|---|
| PubChem CID | 117275448 |
| Molecular Formula | C9H9FO5S2 |
| Molecular Weight | 280.30 g/mol |
| Exact Mass | 279.99 |
| IUPAC Name | 3-fluoro-4,5-bis(methylsulfonyl)benzaldehyde |
| SMILES | CS(=O)(=O)c1cc(C=O)cc(F)c1S(C)(=O)=O |
| InChI | InChI=1S/C9H9FO5S2/c1-16(12,13)8-4-6(5-11)3-7(10)9(8)17(2,14)15/h3-5H,1-2H3 |
| InChIKey | COFUTQGYXMNJNX-UHFFFAOYSA-N |
| XLogP | 0.45 |
| TPSA | 85.35 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 280.30 |
| LogP ≤ 5 | 0.45 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'} |
|---|