C8H6F2OS — CID 117275473
2,5-difluoro-3-methylsulfanylbenzaldehyde (PubChem CID 117275473) has the molecular formula C8H6F2OS and a molecular weight of 188.20 g/mol. Its IUPAC name is 2,5-difluoro-3-methylsulfanylbenzaldehyde.
| Compound Name | 2,5-difluoro-3-methylsulfanylbenzaldehyde |
|---|---|
| PubChem CID | 117275473 |
| Molecular Formula | C8H6F2OS |
| Molecular Weight | 188.20 g/mol |
| Exact Mass | 188.01 |
| IUPAC Name | 2,5-difluoro-3-methylsulfanylbenzaldehyde |
| SMILES | CSc1cc(F)cc(C=O)c1F |
| InChI | InChI=1S/C8H6F2OS/c1-12-7-3-6(9)2-5(4-11)8(7)10/h2-4H,1H3 |
| InChIKey | FALGBFVFBPVUKT-UHFFFAOYSA-N |
| XLogP | 2.50 |
| TPSA | 17.07 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 12 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 188.20 |
| LogP ≤ 5 | 2.50 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'} |
|---|