C20H23NO4 — CID 11727566
(Z,1S,5R)-5-methyl-1-(4-nitrophenyl)-6-phenylmethoxyhex-3-en-1-ol (PubChem CID 11727566) has the molecular formula C20H23NO4 and a molecular weight of 341.41 g/mol. Its IUPAC name is (Z,1S,5R)-5-methyl-1-(4-nitrophenyl)-6-phenylmethoxyhex-3-en-1-ol.
| Compound Name | (Z,1S,5R)-5-methyl-1-(4-nitrophenyl)-6-phenylmethoxyhex-3-en-1-ol |
|---|---|
| PubChem CID | 11727566 |
| Molecular Formula | C20H23NO4 |
| Molecular Weight | 341.41 g/mol |
| Exact Mass | 341.16 |
| IUPAC Name | (Z,1S,5R)-5-methyl-1-(4-nitrophenyl)-6-phenylmethoxyhex-3-en-1-ol |
| SMILES | C[C@H](/C=C\C[C@H](O)c1ccc([N+](=O)[O-])cc1)COCc1ccccc1 |
| InChI | InChI=1S/C20H23NO4/c1-16(14-25-15-17-7-3-2-4-8-17)6-5-9-20(22)18-10-12-19(13-11-18)21(23)24/h2-8,10-13,16,20,22H,9,14-15H2,1H3/b6-5-/t16-,20+/m1/s1 |
| InChIKey | FHQNGWBKAOQJPA-VPCYTDGVSA-N |
| XLogP | 4.43 |
| TPSA | 72.60 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 341.41 |
| LogP ≤ 5 | 4.43 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|